Difference between revisions of "CPD-3481"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2541 RXN-2541] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == * smiles: ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) * common name: ** bup...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == |
− | * | + | * smiles: |
− | ** | + | ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) |
− | * | + | * common name: |
− | ** | + | ** bupropion |
+ | * inchi key: | ||
+ | ** InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O | ||
+ | * molecular weight: | ||
+ | ** 240.752 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (-)-2-(tert-butylamino)-3'-chloropropiophenone | ||
+ | ** 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)- | ||
+ | ** (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone | ||
+ | ** amfebutamonum | ||
+ | ** α-(tert-butylamino)-m-chloropropiophenone | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN66-181]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * DRUGBANK : DB01156 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24849133 24849133] |
− | + | * HMDB : HMDB01510 | |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3219 3219] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06860 C06860] |
− | {{#set: | + | {{#set: smiles=CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)}} |
+ | {{#set: common name=bupropion}} | ||
+ | {{#set: inchi key=InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O}} | ||
+ | {{#set: molecular weight=240.752 }} | ||
+ | {{#set: common name=(-)-2-(tert-butylamino)-3'-chloropropiophenone|1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-|(+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone|amfebutamonum|α-(tert-butylamino)-m-chloropropiophenone}} | ||
+ | {{#set: consumed by=RXN66-181}} |
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite CPD-3481
- smiles:
- CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
- common name:
- bupropion
- inchi key:
- InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
- molecular weight:
- 240.752
- Synonym(s):
- (-)-2-(tert-butylamino)-3'-chloropropiophenone
- 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
- (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
- amfebutamonum
- α-(tert-butylamino)-m-chloropropiophenone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)" cannot be used as a page name in this wiki.