Difference between revisions of "CPD-3481"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2541 RXN-2541] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == * smiles: ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) * common name: ** bup...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2541 RXN-2541] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.5.1.115 EC-2.5.1.115]
+
** bupropion
 +
* inchi key:
 +
** InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
 +
* molecular weight:
 +
** 240.752   
 
* Synonym(s):
 
* Synonym(s):
 +
** (-)-2-(tert-butylamino)-3'-chloropropiophenone
 +
** 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
 +
** (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
 +
** amfebutamonum
 +
** α-(tert-butylamino)-m-chloropropiophenone
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-181]]
−
** 1 [[PHYTYL-PYROPHOSPHATE]][c] '''+''' 1 [[HOMOGENTISATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[MPBQ]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 phytyl diphosphate[c] '''+''' 1 homogentisate[c] '''+''' 1 H+[c] '''=>''' 1 diphosphate[c] '''+''' 1 2-methyl-6-phytyl-1,4-benzoquinol[c] '''+''' 1 CO2[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_13582]]
+
−
** Source: [[orthology-athaliana]]
+
−
** Source: [[orthology-synechocystis]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
== Pathways  ==
+
−
* [[PWY-1422]], vitamin E biosynthesis (tocopherols): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1422 PWY-1422]
+
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-synechocystis]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* DRUGBANK : DB01156
−
** [http://www.genome.jp/dbget-bin/www_bget?R07500 R07500]
+
* PUBCHEM:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24849133 24849133]
−
{{#set: ec number=EC-2.5.1.115}}
+
* HMDB : HMDB01510
−
{{#set: gene associated=Tiso_gene_13582}}
+
* CHEBI:
−
{{#set: in pathway=PWY-1422}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3219 3219]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii|orthology-synechocystis}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06860 C06860]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)}}
 +
{{#set: common name=bupropion}}
 +
{{#set: inchi key=InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O}}
 +
{{#set: molecular weight=240.752    }}
 +
{{#set: common name=(-)-2-(tert-butylamino)-3'-chloropropiophenone|1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-|(+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone|amfebutamonum|α-(tert-butylamino)-m-chloropropiophenone}}
 +
{{#set: consumed by=RXN66-181}}

Latest revision as of 21:17, 21 March 2018

Metabolite CPD-3481

  • smiles:
    • CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
  • common name:
    • bupropion
  • inchi key:
    • InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
  • molecular weight:
    • 240.752
  • Synonym(s):
    • (-)-2-(tert-butylamino)-3'-chloropropiophenone
    • 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
    • (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
    • amfebutamonum
    • α-(tert-butylamino)-m-chloropropiophenone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-3481&oldid=47502"