Difference between revisions of "Tiso gene 13463"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == * smiles: ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) *...")
 
(Created page with "Category:Gene == Gene Tiso_gene_13463 == * right end position: ** 4689 * transcription direction: ** POSITIVE * left end position: ** 2389 * centisome position: ** 38.0777...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] ==
+
== Gene Tiso_gene_13463 ==
−
* smiles:
+
* right end position:
−
** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))
+
** 4689
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 5-hydroxytryptophol glucuronide
+
** 2389
−
* molecular weight:
+
* centisome position:
−
** 353.328    
+
** 38.07778    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.7.1.148-RXN]]
−
* [[RXN-10784]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[NONMEVIPP-PWY]]
 +
* [[PWY-7560]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4689}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173086 46173086]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))}}
+
{{#set: left end position=2389}}
−
{{#set: inchi key=InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N}}
+
{{#set: centisome position=38.07778    }}
−
{{#set: common name=5-hydroxytryptophol glucuronide}}
+
{{#set: reaction associated=2.7.1.148-RXN}}
−
{{#set: molecular weight=353.328    }}
+
{{#set: pathway associated=NONMEVIPP-PWY|PWY-7560}}
−
{{#set: produced by=RXN-10784}}
+

Latest revision as of 20:17, 21 March 2018

Gene Tiso_gene_13463

  • right end position:
    • 4689
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2389
  • centisome position:
    • 38.07778
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13463&oldid=47503"