Difference between revisions of "HOMO-I-CIT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_19413 == * left end position: ** 867 * transcription direction: ** POSITIVE * right end position: ** 2300 * centisome position: ** 37.06712...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == * smiles: ** C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-] * common name: **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_19413 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] ==
* left end position:
+
* smiles:
** 867
+
** C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-]
* transcription direction:
+
* common name:
** POSITIVE
+
** (1R,2S)-homoisocitrate
* right end position:
+
* inchi key:
** 2300
+
** InChIKey=OEJZZCGRGVFWHK-WVZVXSGGSA-K
* centisome position:
+
* molecular weight:
** 37.06712    
+
** 203.128    
 
* Synonym(s):
 
* Synonym(s):
 +
** (-)-threo-isohomocitrate
 +
** (-)-1-hydroxy-1,2,4-butanetricarboxylate
 +
** homo-I-cit
 +
** 1-hydroxy-1,2,4-butanetricarboxylate
 +
** 2-hydroxy-3-carboxyadipate
 +
** homo-iso-citrate
 +
** 1-(R)-hydroxy-2-(S)-1,2,4-butanetricarboxylic acid
 +
** 1-hydroxybutane-1,2,4-tricarboxylate
 +
** (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylate
 +
** homoisocitrate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[CARBODEHYDRAT-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
== Reaction(s) of unknown directionality ==
***ec-number
+
* [[HOMOACONITATE-HYDRATASE-RXN]]
* [[RXN0-5224]]
+
* [[RXN-13722]]
** in-silico_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-241]]
+
* [[PWYQT-4429]]
+
* [[PWY-7117]]
+
* [[PWY-7115]]
+
* [[PWY-6142]]
+
* [[CYANCAT-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=867}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459812 5459812]
{{#set: right end position=2300}}
+
* CHEMSPIDER:
{{#set: centisome position=37.06712   }}
+
** [http://www.chemspider.com/Chemical-Structure.4573580.html 4573580]
{{#set: reaction associated=CARBODEHYDRAT-RXN|RXN0-5224}}
+
* CHEBI:
{{#set: pathway associated=PWY-241|PWYQT-4429|PWY-7117|PWY-7115|PWY-6142|CYANCAT-PWY}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15404 15404]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05662 C05662]
 +
{{#set: smiles=C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-]}}
 +
{{#set: common name=(1R,2S)-homoisocitrate}}
 +
{{#set: inchi key=InChIKey=OEJZZCGRGVFWHK-WVZVXSGGSA-K}}
 +
{{#set: molecular weight=203.128   }}
 +
{{#set: common name=(-)-threo-isohomocitrate|(-)-1-hydroxy-1,2,4-butanetricarboxylate|homo-I-cit|1-hydroxy-1,2,4-butanetricarboxylate|2-hydroxy-3-carboxyadipate|homo-iso-citrate|1-(R)-hydroxy-2-(S)-1,2,4-butanetricarboxylic acid|1-hydroxybutane-1,2,4-tricarboxylate|(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylate|homoisocitrate}}
 +
{{#set: reversible reaction associated=HOMOACONITATE-HYDRATASE-RXN|RXN-13722}}

Latest revision as of 20:17, 21 March 2018

Metabolite HOMO-I-CIT

  • smiles:
    • C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-]
  • common name:
    • (1R,2S)-homoisocitrate
  • inchi key:
    • InChIKey=OEJZZCGRGVFWHK-WVZVXSGGSA-K
  • molecular weight:
    • 203.128
  • Synonym(s):
    • (-)-threo-isohomocitrate
    • (-)-1-hydroxy-1,2,4-butanetricarboxylate
    • homo-I-cit
    • 1-hydroxy-1,2,4-butanetricarboxylate
    • 2-hydroxy-3-carboxyadipate
    • homo-iso-citrate
    • 1-(R)-hydroxy-2-(S)-1,2,4-butanetricarboxylic acid
    • 1-hydroxybutane-1,2,4-tricarboxylate
    • (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylate
    • homoisocitrate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-" cannot be used as a page name in this wiki.