Difference between revisions of "RXN-15068"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] == * smiles: ** CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15068 RXN-15068] == * direction: ** LEFT-TO-RIGHT * common name: ** phospholipase A2 ** ORF **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15068 RXN-15068] ==
−
* smiles:
+
* direction:
−
** CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M
+
 
* common name:
 
* common name:
−
** primary fluorescent chlorophyll catabolite
+
** phospholipase A2
−
* molecular weight:
+
** ORF
−
** 626.708   
+
** abhydrolase_domain-containing_protein_4-like
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4]
 
* Synonym(s):
 
* Synonym(s):
−
** pFCC
 
−
** (82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-7741]]
+
** 1 [[CPD-8268]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[L-1-LYSOPHOSPHATIDATE]][c] '''+''' 1 [[OLEATE-CPD]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 dioleoyl phosphatidate[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 1-oleyl-2-lyso-phosphatidate[c] '''+''' 1 oleate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15047]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_12960]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_15046]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_12959]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7417]], phospholipid remodeling (phosphatidate, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7417 PWY-7417]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819909 91819909]
+
{{#set: common name=phospholipase A2}}
−
* CHEBI:
+
{{#set: common name=ORF}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58719 58719]
+
{{#set: common name=abhydrolase_domain-containing_protein_4-like}}
−
{{#set: smiles=CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)}}
+
{{#set: ec number=EC-3.1.1.4}}
−
{{#set: inchi key=InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M}}
+
{{#set: gene associated=Tiso_gene_15047|Tiso_gene_12960|Tiso_gene_15046|Tiso_gene_12959}}
−
{{#set: common name=primary fluorescent chlorophyll catabolite}}
+
{{#set: in pathway=PWY-7417}}
−
{{#set: molecular weight=626.708    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=pFCC|(82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
{{#set: produced by=RXN-7741}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:17, 21 March 2018

Reaction RXN-15068

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • phospholipase A2
    • ORF
    • abhydrolase_domain-containing_protein_4-like
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7417, phospholipid remodeling (phosphatidate, yeast): PWY-7417
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15068&oldid=47507"