Difference between revisions of "CPD-13227"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17487 RXN-17487] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13227 CPD-13227] == * smiles: ** CC(=O)NC1(C(O)OC(CO)C(C(O)1)OC2(C(NC(C)=O)C(O)C(C(CO)O2)OC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17487 RXN-17487] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13227 CPD-13227] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(=O)NC1(C(O)OC(CO)C(C(O)1)OC2(C(NC(C)=O)C(O)C(C(CO)O2)OC3(OC(C(O)C(O)C(NC(C)=O)3)CO)))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.3.99 EC-1.3.99]
+
** N,N',N''-triacetylchitotriose
 +
* inchi key:
 +
** InChIKey=WZZVUHWLNMNWLW-MEWKLCDLSA-N
 +
* molecular weight:
 +
** 627.598   
 
* Synonym(s):
 
* Synonym(s):
 +
** triacetylchitotriose
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-12626]]
−
** 1 [[Acceptor]][c] '''+''' 1 [[DIVINYL-PROTOCHLOROPHYLLIDE-A]][c] '''<=>''' 1 [[CPD-10337]][c] '''+''' 1 [[Donor-H2]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an oxidized electron acceptor[c] '''+''' 1 3,8-divinyl protochlorophyllide a[c] '''<=>''' 1 chlorophyll c2[c] '''+''' 1 a reduced electron acceptor[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[gap-filling]]
+
−
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
*** Tool: [[meneco]]
+
−
**** Comment: [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.3.99}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10930193 10930193]
−
{{#set: in pathway=}}
+
* CHEMSPIDER:
−
{{#set: reconstruction category=gap-filling}}
+
** [http://www.chemspider.com/Chemical-Structure.392429.html 392429]
−
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
+
* CHEBI:
−
{{#set: reconstruction tool=meneco}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71404 71404]
−
{{#set: reconstruction comment=added for gapfilling}}
+
{{#set: smiles=CC(=O)NC1(C(O)OC(CO)C(C(O)1)OC2(C(NC(C)=O)C(O)C(C(CO)O2)OC3(OC(C(O)C(O)C(NC(C)=O)3)CO)))}}
 +
{{#set: common name=N,N',N''-triacetylchitotriose}}
 +
{{#set: inchi key=InChIKey=WZZVUHWLNMNWLW-MEWKLCDLSA-N}}
 +
{{#set: molecular weight=627.598    }}
 +
{{#set: common name=triacetylchitotriose}}
 +
{{#set: consumed by=RXN-12626}}

Latest revision as of 20:17, 21 March 2018

Metabolite CPD-13227

  • smiles:
    • CC(=O)NC1(C(O)OC(CO)C(C(O)1)OC2(C(NC(C)=O)C(O)C(C(CO)O2)OC3(OC(C(O)C(O)C(NC(C)=O)3)CO)))
  • common name:
    • N,N',N-triacetylchitotriose
  • inchi key:
    • InChIKey=WZZVUHWLNMNWLW-MEWKLCDLSA-N
  • molecular weight:
    • 627.598
  • Synonym(s):
    • triacetylchitotriose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13227&oldid=47540"