Difference between revisions of "CPD-7013"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-521 RXN66-521] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7013 CPD-7013] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-521 RXN66-521] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7013 CPD-7013] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))
 +
* common name:
 +
** geranylgeranyl chlorophyll b
 +
* molecular weight:
 +
** 901.439   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[ATP]][c] '''+''' 1.0 [[Glucopyranose]][c] '''=>''' 1.0 [[D-glucopyranose-6-phosphate]][c] '''+''' 1.0 [[ADP]][c] '''+''' 1.0 [[PROTON]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-7673]]
−
** 1.0 ATP[c] '''+''' 1.0 D-glucopyranose[c] '''=>''' 1.0 D-glucopyranose 6-phosphate[c] '''+''' 1.0 ADP[c] '''+''' 1.0 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_1303]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_1303}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245917 25245917]
−
{{#set: in pathway=}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=geranylgeranyl chlorophyll b}}
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
{{#set: molecular weight=901.439    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: reversible reaction associated=RXN-7673}}

Latest revision as of 20:17, 21 March 2018

Metabolite CPD-7013

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • geranylgeranyl chlorophyll b
  • molecular weight:
    • 901.439
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-7013&oldid=47543"