Difference between revisions of "Tiso gene 17372"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] == * smiles: ** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InChI...")
(Created page with "Category:Gene == Gene Tiso_gene_17372 == * right end position: ** 3738 * transcription direction: ** POSITIVE * left end position: ** 2233 * centisome position: ** 59.6261...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3481 CPD-3481] ==
+
== Gene Tiso_gene_17372 ==
−
* smiles:
+
* right end position:
−
** CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)
+
** 3738
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O
+
** POSITIVE
−
* common name:
+
* left end position:
−
** bupropion
+
** 2233
−
* molecular weight:
+
* centisome position:
−
** 240.752    
+
** 59.626167    
 
* Synonym(s):
 
* Synonym(s):
−
** (-)-2-(tert-butylamino)-3'-chloropropiophenone
 
−
** 1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-
 
−
** (+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone
 
−
** amfebutamonum
 
−
** α-(tert-butylamino)-m-chloropropiophenone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-181]]
+
* Reaction: [[2.7.1.160-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-experimental_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6689]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB01156
+
{{#set: right end position=3738}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24849133 24849133]
+
{{#set: left end position=2233}}
−
* CHEBI:
+
{{#set: centisome position=59.626167   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3219 3219]
+
{{#set: reaction associated=2.7.1.160-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6689}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06860 C06860]
+
−
* HMDB : HMDB01510
+
−
{{#set: smiles=CC([N+]C(C)(C)C)C(=O)C1(C=CC=C(Cl)C=1)}}
+
−
{{#set: inchi key=InChIKey=SNPPWIUOZRMYNY-UHFFFAOYSA-O}}
+
−
{{#set: common name=bupropion}}
+
−
{{#set: molecular weight=240.752   }}
+
−
{{#set: common name=(-)-2-(tert-butylamino)-3'-chloropropiophenone|1-propanone, 1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-,(+-)-|(+-)-1-(3-chlorophenyl)-2-((1,1-dimethylethyl)amino)-1-propanone|amfebutamonum|α-(tert-butylamino)-m-chloropropiophenone}}
+
−
{{#set: consumed by=RXN66-181}}
+

Latest revision as of 20:17, 21 March 2018

Gene Tiso_gene_17372

  • right end position:
    • 3738
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2233
  • centisome position:
    • 59.626167
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17372&oldid=47550"