Difference between revisions of "Sugar-alcohols"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == * smiles: ** C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-] * inchi key: ** I...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sugar-alcohols Sugar-alcohols] == * common name: ** a sugar alcohol * Synonym(s): ** a glycitol...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sugar-alcohols Sugar-alcohols] ==
−
* smiles:
+
−
** C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-]
+
−
* inchi key:
+
−
** InChIKey=OEJZZCGRGVFWHK-WVZVXSGGSA-K
+
 
* common name:
 
* common name:
−
** (1R,2S)-homoisocitrate
+
** a sugar alcohol
−
* molecular weight:
+
−
** 203.128   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (-)-threo-isohomocitrate
+
** a glycitol
−
** (-)-1-hydroxy-1,2,4-butanetricarboxylate
+
** an alditol
−
** homo-I-cit
+
** a polyalcohol
−
** 1-hydroxy-1,2,4-butanetricarboxylate
+
** a polyhydric alcohol
−
** 2-hydroxy-3-carboxyadipate
+
** a polyol
−
** homo-iso-citrate
+
−
** 1-(R)-hydroxy-2-(S)-1,2,4-butanetricarboxylic acid
+
−
** 1-hydroxybutane-1,2,4-tricarboxylate
+
−
** (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylate
+
−
** homoisocitrate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9926]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[HOMOACONITATE-HYDRATASE-RXN]]
+
* [[ALDEHYDE-REDUCTASE-RXN]]
−
* [[RXN-13722]]
+
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a sugar alcohol}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459812 5459812]
+
{{#set: common name=a glycitol|an alditol|a polyalcohol|a polyhydric alcohol|a polyol}}
−
* CHEMSPIDER:
+
{{#set: consumed by=RXN-9926}}
−
** [http://www.chemspider.com/Chemical-Structure.4573580.html 4573580]
+
{{#set: reversible reaction associated=ALDEHYDE-REDUCTASE-RXN}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15404 15404]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C05662 C05662]
+
−
{{#set: smiles=C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=OEJZZCGRGVFWHK-WVZVXSGGSA-K}}
+
−
{{#set: common name=(1R,2S)-homoisocitrate}}
+
−
{{#set: molecular weight=203.128    }}
+
−
{{#set: common name=(-)-threo-isohomocitrate|(-)-1-hydroxy-1,2,4-butanetricarboxylate|homo-I-cit|1-hydroxy-1,2,4-butanetricarboxylate|2-hydroxy-3-carboxyadipate|homo-iso-citrate|1-(R)-hydroxy-2-(S)-1,2,4-butanetricarboxylic acid|1-hydroxybutane-1,2,4-tricarboxylate|(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylate|homoisocitrate}}
+
−
{{#set: consumed or produced by=HOMOACONITATE-HYDRATASE-RXN|RXN-13722}}
+

Latest revision as of 20:17, 21 March 2018

Metabolite Sugar-alcohols

  • common name:
    • a sugar alcohol
  • Synonym(s):
    • a glycitol
    • an alditol
    • a polyalcohol
    • a polyhydric alcohol
    • a polyol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Sugar-alcohols&oldid=47553"