Difference between revisions of "Sugar-alcohols"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sugar-alcohols Sugar-alcohols] == * common name: ** a sugar alcohol * Synonym(s): ** a glycitol...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sugar-alcohols Sugar-alcohols] ==
* smiles:
+
** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
 
* common name:
 
* common name:
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
+
** a sugar alcohol
* inchi key:
+
** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
+
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
** 5α-cholesta-8,24-dien-3β-ol
+
** a glycitol
** 4α,14α-dimethylzymosterol
+
** an alditol
** 29-norlanosterol
+
** a polyalcohol
 +
** a polyhydric alcohol
 +
** a polyol
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11881]]
+
* [[RXN-9926]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[ALDEHYDE-REDUCTASE-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a sugar alcohol}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15101557 15101557]
+
{{#set: common name=a glycitol|an alditol|a polyalcohol|a polyhydric alcohol|a polyol}}
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: consumed by=RXN-9926}}
{{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: reversible reaction associated=ALDEHYDE-REDUCTASE-RXN}}
{{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}}
+
{{#set: molecular weight=412.698    }}
+
{{#set: common name=5α-cholesta-8,24-dien-3β-ol|4α,14α-dimethylzymosterol|29-norlanosterol}}
+
{{#set: consumed by=RXN-11881}}
+

Latest revision as of 20:17, 21 March 2018

Metabolite Sugar-alcohols

  • common name:
    • a sugar alcohol
  • Synonym(s):
    • a glycitol
    • an alditol
    • a polyalcohol
    • a polyhydric alcohol
    • a polyol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links