Difference between revisions of "Tiso gene 8397"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-]...")
(Created page with "Category:Gene == Gene Tiso_gene_8397 == * right end position: ** 424 * transcription direction: ** POSITIVE * left end position: ** 1 * centisome position: ** 9.714396600e...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] ==
+
== Gene Tiso_gene_8397 ==
−
* smiles:
+
* right end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 424
−
* common name:
+
* transcription direction:
−
** ω-carboxy-(9Z)-octadec-9-enoyl-CoA
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I
+
** 1
−
* molecular weight:
+
* centisome position:
−
** 1056.928   
+
** 9.714396600e-3
 
* Synonym(s):
 
* Synonym(s):
−
** 18-carboxyl oleoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RNA-LIGASE-ATP-RXN]]
−
* [[RXN-16418]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-17925]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17926]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17927]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=424}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820430 91820430]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=1}}
−
{{#set: common name=ω-carboxy-(9Z)-octadec-9-enoyl-CoA}}
+
{{#set: centisome position=9.714396600e-3}}
−
{{#set: inchi key=InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I}}
+
{{#set: reaction associated=RNA-LIGASE-ATP-RXN|RXN-17925|RXN-17926|RXN-17927}}
−
{{#set: molecular weight=1056.928    }}
+
−
{{#set: common name=18-carboxyl oleoyl-CoA}}
+
−
{{#set: produced by=RXN-16418}}
+

Latest revision as of 21:17, 21 March 2018

Gene Tiso_gene_8397

  • right end position:
    • 424
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1
  • centisome position:
    • 9.714396600e-3
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8397&oldid=47559"