Difference between revisions of "RXN0-5180"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5180 RXN0-5180] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.5...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5180 RXN0-5180] ==
−
* smiles:
+
* direction:
−
** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
+
** REVERSIBLE
−
* common name:
+
* ec number:
−
** betanidin
+
** [http://enzyme.expasy.org/EC/2.5.1 EC-2.5.1]
−
* inchi key:
+
−
** InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L
+
−
* molecular weight:
+
−
** 386.317   
+
 
* Synonym(s):
 
* Synonym(s):
−
** betanidin radical
 
−
** 2,6-Pyridinedicarboxylic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8635]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[FARNESYL-PP]][c] '''<=>''' 1 [[CPD0-1028]][c] '''+''' 1 [[PPI]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 isopentenyl diphosphate[c] '''+''' 1 (2E,6E)-farnesyl diphosphate[c] '''<=>''' 1 2-cis,6-trans,10-trans-geranylgeranyl diphosphate[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2848]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_8531]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_18201]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_10317]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_11582]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB00217
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31282 31282]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245506 25245506]
+
* LIGAND-RXN:
−
* HMDB : HMDB29407
+
** [http://www.genome.jp/dbget-bin/www_bget?R05555 R05555]
−
* CHEBI:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3079 3079]
+
{{#set: ec number=EC-2.5.1}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_2848|Tiso_gene_8531|Tiso_gene_18201|Tiso_gene_10317|Tiso_gene_11582}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08539 C08539]
+
{{#set: in pathway=}}
−
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=betanidin}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=386.317    }}
+
−
{{#set: common name=betanidin radical|2,6-Pyridinedicarboxylic acid}}
+
−
{{#set: consumed by=RXN-8635}}
+

Latest revision as of 20:17, 21 March 2018

Reaction RXN0-5180

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 isopentenyl diphosphate[c] + 1 (2E,6E)-farnesyl diphosphate[c] <=> 1 2-cis,6-trans,10-trans-geranylgeranyl diphosphate[c] + 1 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN0-5180&oldid=47566"