Difference between revisions of "PHYTYL-PYROPHOSPHATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18201 == * Synonym(s): == Reactions associated == * GGPS ** pantograph-creinhardtii * GPPS ** pantograph-creinhardti...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTYL-PYROPHOSPHATE PHYTYL-PYROPHOSPHATE] == * smiles: ** CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTYL-PYROPHOSPHATE PHYTYL-PYROPHOSPHATE] == |
| + | * smiles: | ||
| + | ** CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C | ||
| + | * common name: | ||
| + | ** phytyl diphosphate | ||
| + | * inchi key: | ||
| + | ** InChIKey=ITPLBNCCPZSWEU-PYDDKJGSSA-K | ||
| + | * molecular weight: | ||
| + | ** 453.471 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** phytyl pyrophosphate | ||
| + | ** phytyl-PP | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-2541]] |
| − | + | * [[R06284]] | |
| − | + | * [[R06858]] | |
| − | + | * [[RXN-7674]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10625]] | |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | * | + | * [[RXN-7660]] |
| − | * [[RXN- | + | * [[RXN1F-66]] |
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728454 71728454] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75434 75434] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05427 C05427] | ||
| + | {{#set: smiles=CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}} | ||
| + | {{#set: common name=phytyl diphosphate}} | ||
| + | {{#set: inchi key=InChIKey=ITPLBNCCPZSWEU-PYDDKJGSSA-K}} | ||
| + | {{#set: molecular weight=453.471 }} | ||
| + | {{#set: common name=phytyl pyrophosphate|phytyl-PP}} | ||
| + | {{#set: consumed by=RXN-2541|R06284|R06858|RXN-7674}} | ||
| + | {{#set: produced by=RXN-10625}} | ||
| + | {{#set: reversible reaction associated=RXN-7660|RXN1F-66}} | ||
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite PHYTYL-PYROPHOSPHATE
- smiles:
- CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
- common name:
- phytyl diphosphate
- inchi key:
- InChIKey=ITPLBNCCPZSWEU-PYDDKJGSSA-K
- molecular weight:
- 453.471
- Synonym(s):
- phytyl pyrophosphate
- phytyl-PP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.
