|
|
| (One intermediate revision by the same user not shown) |
| Line 1: |
Line 1: |
| − | [[Category:Gene]] | + | [[Category:Metabolite]] |
| − | == Gene Tiso_gene_13394 == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == |
| − | * left end position: | + | * smiles: |
| − | ** 235 | + | ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) |
| − | * transcription direction: | + | * common name: |
| − | ** POSITIVE | + | ** 4α-hydroxy-tetrahydrobiopterin |
| − | * right end position: | + | * inchi key: |
| − | ** 6220 | + | ** InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N |
| − | * centisome position: | + | * molecular weight: |
| − | ** 3.7160025 | + | ** 257.249 |
| | * Synonym(s): | | * Synonym(s): |
| | + | ** 4α-hydroxy-5,6,7,8-tetrahydrobiopterin |
| | + | ** 4α-hydroxy-tetrahydropterin |
| | + | ** 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin |
| | | | |
| − | == Reactions associated == | + | == Reaction(s) known to consume the compound == |
| − | * [[2.3.1.165-RXN]] | + | * [[RXN-7908]] |
| − | ** in-silico_annotation
| + | == Reaction(s) known to produce the compound == |
| − | ***ec-number
| + | == Reaction(s) of unknown directionality == |
| − | * [[3-HYDROXYDECANOYL-ACP-DEHYDR-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[3-OXOACYL-ACP-REDUCT-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[3-OXOACYL-ACP-SYNTH-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[4.2.1.58-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[4.2.1.59-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[4.2.1.61-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[ACP-S-ACETYLTRANSFER-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[ACYLCOASYN-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[ENOYL-ACP-REDUCT-NADPH-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[FATTY-ACYL-COA-SYNTHASE-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[LINOLENOYL-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[MALONYL-COA-ACP-TRANSACYL-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[PROTEIN-TYROSINE-SULFOTRANSFERASE-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[R223-RXN]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-12184]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-12560]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-12978]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-13008]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-13279]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-13290]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-13614]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-16380]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-16389]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-16393]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-16401]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-16402]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-16415]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-16418]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-5901]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-7904]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9514]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9515]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9518]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9520]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9521]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9524]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9526]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9528]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9530]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9532]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9533]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9534]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9535]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9536]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9537]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9538]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9540]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9542]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9623]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9633]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9634]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9644]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9648]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9650]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9651]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9652]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9653]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9654]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9655]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN-9673]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN0-7238]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN0-7239]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN0-7248]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN3O-1803]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN3O-5293]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN3O-5304]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN66-469]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN66-477]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN66-480]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN66-483]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[RXN66-484]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | * [[TRANS-RXN0-623]]
| + | |
| − | ** in-silico_annotation
| + | |
| − | ***ec-number
| + | |
| − | == Pathways associated == | + | |
| − | * [[PWY-6920]]
| + | |
| − | * [[PWY-7664]]
| + | |
| − | * [[P221-PWY]]
| + | |
| − | * [[PWY-7388]]
| + | |
| − | * [[PWY-321]]
| + | |
| − | * [[PWY-5972]]
| + | |
| − | * [[PWY-5970]]
| + | |
| − | * [[PWY-5971]]
| + | |
| − | * [[PWY-7033]]
| + | |
| − | * [[PWY-5676]]
| + | |
| − | * [[PWY-5136]]
| + | |
| − | * [[PWY66-389]]
| + | |
| − | * [[PWY-7288]]
| + | |
| − | * [[PWY-4381]]
| + | |
| − | * [[PWY-7490]]
| + | |
| − | * [[PWY-6733]]
| + | |
| − | * [[PWY-7094]]
| + | |
| − | * [[PWY66-391]]
| + | |
| − | * [[PWY0-862]]
| + | |
| − | * [[PWY-5994]]
| + | |
| − | * [[PWY3O-355]]
| + | |
| − | * [[FAO-PWY]]
| + | |
| − | * [[PWY-1121]]
| + | |
| − | * [[PWY-6873]]
| + | |
| − | * [[PWY-5965]]
| + | |
| − | * [[PWY-5966]]
| + | |
| − | * [[PWY-5143]]
| + | |
| − | * [[FASYN-INITIAL-PWY]]
| + | |
| − | * [[PWY-5885]]
| + | |
| − | * [[PWY-7724]]
| + | |
| − | * [[PWY-5741]]
| + | |
| − | * [[FASYN-ELONG-PWY]]
| + | |
| − | * [[PWY-6001]]
| + | |
| − | * [[PWY-7216]]
| + | |
| − | * [[PWY-5147]]
| + | |
| − | * [[PWY-7049]]
| + | |
| − | * [[PWY-6799]]
| + | |
| − | * [[PWY-6000]]
| + | |
| − | * [[PWY66-387]]
| + | |
| − | * [[PWY-5989]]
| + | |
| − | * [[PWY1-3]]
| + | |
| − | * [[PWY-6803]]
| + | |
| − | * [[PWY66-388]]
| + | |
| | == External links == | | == External links == |
| − | {{#set: left end position=235}} | + | * PUBCHEM: |
| − | {{#set: transcription direction=POSITIVE}} | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657593 90657593] |
| − | {{#set: right end position=6220}} | + | * HMDB : HMDB02281 |
| − | {{#set: centisome position=3.7160025 }} | + | * CHEBI: |
| − | {{#set: reaction associated=2.3.1.165-RXN|3-HYDROXYDECANOYL-ACP-DEHYDR-RXN|3-OXOACYL-ACP-REDUCT-RXN|3-OXOACYL-ACP-SYNTH-BASE-RXN|3-OXOACYL-ACP-SYNTH-RXN|4.2.1.58-RXN|4.2.1.59-RXN|4.2.1.61-RXN|ACP-S-ACETYLTRANSFER-RXN|ACYLCOASYN-RXN|ENOYL-ACP-REDUCT-NADPH-RXN|FATTY-ACYL-COA-SYNTHASE-RXN|LINOLENOYL-RXN|MALONYL-COA-ACP-TRANSACYL-RXN|PROTEIN-TYROSINE-SULFOTRANSFERASE-RXN|R223-RXN|RXN-12184|RXN-12560|RXN-12978|RXN-13008|RXN-13279|RXN-13290|RXN-13614|RXN-16380|RXN-16389|RXN-16393|RXN-16401|RXN-16402|RXN-16415|RXN-16418|RXN-5901|RXN-7904|RXN-9514|RXN-9515|RXN-9518|RXN-9520|RXN-9521|RXN-9524|RXN-9526|RXN-9528|RXN-9530|RXN-9532|RXN-9533|RXN-9534|RXN-9535|RXN-9536|RXN-9537|RXN-9538|RXN-9540|RXN-9542|RXN-9623|RXN-9633|RXN-9634|RXN-9644|RXN-9648|RXN-9650|RXN-9651|RXN-9652|RXN-9653|RXN-9654|RXN-9655|RXN-9673|RXN0-7238|RXN0-7239|RXN0-7248|RXN3O-1803|RXN3O-5293|RXN3O-5304|RXN66-469|RXN66-477|RXN66-480|RXN66-483|RXN66-484|TRANS-RXN0-623}} | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15374 15374] |
| − | {{#set: pathway associated=PWY-6920|PWY-7664|P221-PWY|PWY-7388|PWY-321|PWY-5972|PWY-5970|PWY-5971|PWY-7033|PWY-5676|PWY-5136|PWY66-389|PWY-7288|PWY-4381|PWY-7490|PWY-6733|PWY-7094|PWY66-391|PWY0-862|PWY-5994|PWY3O-355|FAO-PWY|PWY-1121|PWY-6873|PWY-5965|PWY-5966|PWY-5143|FASYN-INITIAL-PWY|PWY-5885|PWY-7724|PWY-5741|FASYN-ELONG-PWY|PWY-6001|PWY-7216|PWY-5147|PWY-7049|PWY-6799|PWY-6000|PWY66-387|PWY-5989|PWY1-3|PWY-6803|PWY66-388}} | + | * LIGAND-CPD: |
| | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15522 C15522] |
| | + | {{#set: smiles=CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))}} |
| | + | {{#set: common name=4α-hydroxy-tetrahydrobiopterin}} |
| | + | {{#set: inchi key=InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N}} |
| | + | {{#set: molecular weight=257.249 }} |
| | + | {{#set: common name=4α-hydroxy-5,6,7,8-tetrahydrobiopterin|4α-hydroxy-tetrahydropterin|6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin}} |
| | + | {{#set: consumed by=RXN-7908}} |
