Difference between revisions of "Long-Chain-Fatty-Acids"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] == * smiles: ** C(C([N+])C(=O)[O-])S([O-])=O * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Fatty-Acids Long-Chain-Fatty-Acids] == * common name: ** a long-chain fatty acid * S...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Fatty-Acids Long-Chain-Fatty-Acids] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a long-chain fatty acid |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** LCFA |
− | ** | + | ** Long-Chain-Fatty-Acids |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7904]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PHOSPHOLIPASE-A2-RXN]] |
+ | * [[RXN-12575]] | ||
+ | * [[RXN-17736]] | ||
+ | * [[RXN-12579]] | ||
+ | * [[RXN-17735]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a long-chain fatty acid}} | |
− | + | {{#set: common name=LCFA|Long-Chain-Fatty-Acids}} | |
− | + | {{#set: consumed by=RXN-7904}} | |
− | + | {{#set: produced by=PHOSPHOLIPASE-A2-RXN|RXN-12575|RXN-17736|RXN-12579|RXN-17735}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite Long-Chain-Fatty-Acids
- common name:
- a long-chain fatty acid
- Synonym(s):
- LCFA
- Long-Chain-Fatty-Acids