Difference between revisions of "CPDQT-4"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTYL-PYROPHOSPHATE PHYTYL-PYROPHOSPHATE] == * smiles: ** CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * common name: ** &b...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** β-L-galactose 1-phosphate |
| + | * inchi key: | ||
| + | ** InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXNQT-4142]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728461 71728461] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75522 75522] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15926 C15926] |
| − | {{#set: smiles= | + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)}} |
| − | {{#set: | + | {{#set: common name=β-L-galactose 1-phosphate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=258.121 }} |
| − | + | {{#set: consumed by=RXNQT-4142}} | |
| − | {{#set: consumed by= | + | |
| − | + | ||
| − | + | ||
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite CPDQT-4
- smiles:
- C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
- common name:
- β-L-galactose 1-phosphate
- inchi key:
- InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
- molecular weight:
- 258.121
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)" cannot be used as a page name in this wiki.
