Difference between revisions of "CPD1F-90"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.8.11-RXN 2.7.8.11-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * smiles: ** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3) *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.8.11-RXN 2.7.8.11-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.7.8.11 EC-2.7.8.11]
+
** kaempferol
 +
* inchi key:
 +
** InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 285.232   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-13935]]
−
** 1 [[MYO-INOSITOL]][c] '''+''' 1 [[CDPDIACYLGLYCEROL]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CMP]][c] '''+''' 1 [[L-1-phosphatidyl-inositols]][c]
+
* [[RXN-12510]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 myo-inositol[c] '''+''' 1 a CDP-diacylglycerol[c] '''=>''' 1 H+[c] '''+''' 1 CMP[c] '''+''' 1 an L-1-phosphatidyl-inositol[c]
+
* [[RXN1F-93]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_6541]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PHOSLIPSYN2-PWY]], superpathway of phospholipid biosynthesis II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PHOSLIPSYN2-PWY PHOSLIPSYN2-PWY]
+
−
** '''8''' reactions found over '''23''' reactions in the full pathway
+
−
* [[PWY-7625]], phosphatidylinositol biosynthesis II (eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7625 PWY-7625]
+
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
* [[PWY-6351]], D-myo-inositol (1,4,5)-trisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6351 PWY-6351]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6352]], 3-phosphoinositide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6352 PWY-6352]
+
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11580 11580]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202062 25202062]
−
* LIGAND-RXN:
+
* HMDB : HMDB05801
−
** [http://www.genome.jp/dbget-bin/www_bget?R01802 R01802]
+
* CHEBI:
−
* UNIPROT:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58573 58573]
−
** [http://www.uniprot.org/uniprot/P06197 P06197]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P70500 P70500]
+
** [http://www.genome.jp/dbget-bin/www_bget?C05903 C05903]
−
** [http://www.uniprot.org/uniprot/Q8LBA6 Q8LBA6]
+
{{#set: smiles=C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=kaempferol}}
−
{{#set: ec number=EC-2.7.8.11}}
+
{{#set: inchi key=InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M}}
−
{{#set: gene associated=Tiso_gene_6541}}
+
{{#set: molecular weight=285.232    }}
−
{{#set: in pathway=PHOSLIPSYN2-PWY|PWY-7625|PWY-6351|PWY-6352}}
+
{{#set: consumed by=RXN-13935|RXN-12510}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: produced by=RXN1F-93}}
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=esiliculosus}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Latest revision as of 21:18, 21 March 2018

Metabolite CPD1F-90

  • smiles:
    • C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)
  • common name:
    • kaempferol
  • inchi key:
    • InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M
  • molecular weight:
    • 285.232
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD1F-90&oldid=47648"