Difference between revisions of "Tiso gene 18322"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHO-ENOL-PYRUVATE PHOSPHO-ENOL-PYRUVATE] == * smiles: ** C=C(OP([O-])([O-])=O)C([O-])=O * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_18322 == * right end position: ** 2140 * transcription direction: ** POSITIVE * left end position: ** 88 * centisome position: ** 2.8432956...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18322 == |
− | * | + | * right end position: |
− | ** | + | ** 2140 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 88 |
− | * | + | * centisome position: |
− | ** | + | ** 2.8432956 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ADDALT-RXN]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * | + | * Reaction: [[ADENODEAMIN-RXN]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | + | == Pathways associated == | |
− | * [[ | + | * [[PWY-7179]] |
− | * | + | * [[SALVADEHYPOX-PWY]] |
− | == | + | * [[PWY0-1296]] |
− | * [[ | + | * [[PWY-7179-1]] |
− | * [[ | + | * [[PWY-6609]] |
− | * [[ | + | * [[PWY-6611]] |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: right end position=2140}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=88}} | |
− | + | {{#set: centisome position=2.8432956 }} | |
− | + | {{#set: reaction associated=ADDALT-RXN|ADENODEAMIN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7179|SALVADEHYPOX-PWY|PWY0-1296|PWY-7179-1|PWY-6609|PWY-6611}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 20:18, 21 March 2018
Gene Tiso_gene_18322
- right end position:
- 2140
- transcription direction:
- POSITIVE
- left end position:
- 88
- centisome position:
- 2.8432956
- Synonym(s):
Reactions associated
- Reaction: ADDALT-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: ADENODEAMIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation