Difference between revisions of "Tiso gene 3751"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_3751 == * Synonym(s): == Reactions associated == * Reaction: 3.1.3.16-RXN ** Source: orthology-esiliculosus * Reaction: PROTEIN-...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_3751 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[3.1.3.16-RXN]] |
| − | + | ** Source: [[orthology-esiliculosus]] | |
| − | == | + | * Reaction: [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]] |
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=3.1.3.16-RXN|PROTEIN-TYROSINE-PHOSPHATASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 21:18, 21 March 2018
Gene Tiso_gene_3751
- Synonym(s):
Reactions associated
- Reaction: 3.1.3.16-RXN
- Source: orthology-esiliculosus
- Reaction: PROTEIN-TYROSINE-PHOSPHATASE-RXN
- Source: orthology-esiliculosus
