Difference between revisions of "CPD-8563"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14277 CPD-14277] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)CO...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == * smiles: ** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** myosin light-chain phosphate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2.7.11.18-RXN]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03875 C03875] | |
| − | + | {{#set: smiles=C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R]}} | |
| − | ** [http://www. | + | {{#set: common name=myosin light-chain phosphate}} |
| − | {{#set: smiles= | + | {{#set: reversible reaction associated=2.7.11.18-RXN}} |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite CPD-8563
- smiles:
- C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R]
- common name:
- myosin light-chain phosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIGAND-CPD:
"C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R" cannot be used as a page name in this wiki.
