Difference between revisions of "3Z-PHYTOCHROMOBILIN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN] == * direction: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] == |
− | * | + | * smiles: |
− | ** | + | ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O) |
* common name: | * common name: | ||
− | ** | + | ** (3Z)-phytochromobilin |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L |
+ | * molecular weight: | ||
+ | ** 582.655 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[1.3.7.4-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246013 25246013] |
− | + | {{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} | |
− | + | {{#set: common name=(3Z)-phytochromobilin}} | |
− | + | {{#set: inchi key=InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L}} | |
− | + | {{#set: molecular weight=582.655 }} | |
− | {{#set: common name= | + | {{#set: produced by=1.3.7.4-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite 3Z-PHYTOCHROMOBILIN
- smiles:
- CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)
- common name:
- (3Z)-phytochromobilin
- inchi key:
- InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L
- molecular weight:
- 582.655
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.