Difference between revisions of "3-HYDROXY-CISCIS-MUCONATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6543 == * right end position: ** 8908 * transcription direction: ** POSITIVE * left end position: ** 5658 * centisome position: ** 27.56235...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-CISCIS-MUCONATE 3-HYDROXY-CISCIS-MUCONATE] == * smiles: ** C(=CC(=O)[O-])C(O)=CC(=O)[...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-CISCIS-MUCONATE 3-HYDROXY-CISCIS-MUCONATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=CC(=O)[O-])C(O)=CC(=O)[O-] |
| − | * | + | * common name: |
| − | ** | + | ** 3-hydroxy-cis,cis-muconate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 156.095 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | * [[RXN-9922]] | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729369 54729369] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58139 58139] |
| − | {{#set: reaction associated= | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03676 C03676] | ||
| + | {{#set: smiles=C(=CC(=O)[O-])C(O)=CC(=O)[O-]}} | ||
| + | {{#set: common name=3-hydroxy-cis,cis-muconate}} | ||
| + | {{#set: inchi key=InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L}} | ||
| + | {{#set: molecular weight=156.095 }} | ||
| + | {{#set: reversible reaction associated=RXN-9922}} | ||
Latest revision as of 20:19, 21 March 2018
Contents
Metabolite 3-HYDROXY-CISCIS-MUCONATE
- smiles:
- C(=CC(=O)[O-])C(O)=CC(=O)[O-]
- common name:
- 3-hydroxy-cis,cis-muconate
- inchi key:
- InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L
- molecular weight:
- 156.095
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=CC(=O)[O-])C(O)=CC(=O)[O-" cannot be used as a page name in this wiki.
