Difference between revisions of "RXN-10609"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GTP GTP] == * smiles: ** C(OP([O-])(=O)OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10609 RXN-10609] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GTP GTP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10609 RXN-10609] ==
* smiles:
+
* direction:
** C(OP([O-])(=O)OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=XKMLYUALXHKNFT-UUOKFMHZSA-J
+
 
* common name:
 
* common name:
** GTP
+
** exostosin_family_protein
* molecular weight:
+
* ec number:
** 519.151   
+
** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17]
 
* Synonym(s):
 
* Synonym(s):
** guanylyl imidodiphosphate
 
** guanosine 5'-triphosphate
 
** guanosine-triphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-14074]]
+
* With identifiers:
* [[GTP-CYCLOHYDRO-I-RXN]]
+
** 1 [[UDP-GLUCURONATE]][c] '''+''' 1 [[LIOTHYRONINE]][c] '''=>''' 1 [[UDP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-11402]][c]
* [[RXN-14201]]
+
* With common name(s):
* [[RXN-11409]]
+
** 1 UDP-α-D-glucuronate[c] '''+''' 1 3,5,3'-triiodo-L-thyronine[c] '''=>''' 1 UDP[c] '''+''' 1 H+[c] '''+''' 1 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide[c]
* [[RXN-14140]]
+
 
* [[GAMPG]]
+
== Genes associated with this reaction  ==
* [[RME256]]
+
Genes have been associated with this reaction based on different elements listed below.
* [[NTDP]]
+
* Gene: [[Tiso_gene_14140]]
* [[RXN0-5462]]
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-8988]]
+
*** Assignment: EC-NUMBER
* [[GTPPYPHOSKIN-RXN]]
+
* Gene: [[Tiso_gene_14141]]
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
* [[2.7.7.13-RXN]]
+
*** Assignment: EC-NUMBER
* [[RXN-8340]]
+
== Pathways  ==
* [[GTUP]]
+
* [[PWY-6261]], thyroid hormone metabolism II (via conjugation and/or degradation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6261 PWY-6261]
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
** '''11''' reactions found over '''15''' reactions in the full pathway
* [[FE2GTPabc]]
+
== Reconstruction information  ==
* [[GTPA]]
+
* Category: [[annotation]]
* [[GTCY]]
+
** Source: [[annotation-in-silico_annotation]]
* [[GTP-CYCLOHYDRO-II-RXN]]
+
*** Tool: [[pathwaytools]]
== Reaction(s) known to produce the compound ==
+
* [[GDPKIN-RXN]]
+
* [[RXN0-6427]]
+
* [[ATGD]]
+
* [[GTPOP]]
+
== Reaction(s) of unknown directionality ==
+
* [[SUCL_gdp_m]]
+
* [[RXN-14117]]
+
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
+
* [[URKI-RXN]]
+
* [[GUANYLCYC-RXN]]
+
 
== External links  ==
 
== External links  ==
* CAS : 86-01-1
+
{{#set: direction=LEFT-TO-RIGHT}}
* METABOLIGHTS : MTBLC37565
+
{{#set: common name=exostosin_family_protein}}
* PUBCHEM:
+
{{#set: ec number=EC-2.4.1.17}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7058167 7058167]
+
{{#set: gene associated=Tiso_gene_14140|Tiso_gene_14141}}
* HMDB : HMDB01273
+
{{#set: in pathway=PWY-6261}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C00044 C00044]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
* CHEMSPIDER:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.chemspider.com/Chemical-Structure.5414499.html 5414499]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37565 37565]
+
* BIGG : gtp
+
{{#set: smiles=C(OP([O-])(=O)OP(=O)([O-])OP([O-])(=O)[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: inchi key=InChIKey=XKMLYUALXHKNFT-UUOKFMHZSA-J}}
+
{{#set: common name=GTP}}
+
{{#set: molecular weight=519.151    }}
+
{{#set: common name=guanylyl imidodiphosphate|guanosine 5'-triphosphate|guanosine-triphosphate}}
+
{{#set: consumed by=RXN-14074|GTP-CYCLOHYDRO-I-RXN|RXN-14201|RXN-11409|RXN-14140|GAMPG|RME256|NTDP|RXN0-5462|RXN-8988|GTPPYPHOSKIN-RXN|MRNA-GUANYLYLTRANSFERASE-RXN|2.7.7.13-RXN|RXN-8340|GTUP|ADENYLOSUCCINATE-SYNTHASE-RXN|FE2GTPabc|GTPA|GTCY|GTP-CYCLOHYDRO-II-RXN}}
+
{{#set: produced by=GDPKIN-RXN|RXN0-6427|ATGD|GTPOP}}
+
{{#set: consumed or produced by=SUCL_gdp_m|RXN-14117|SUCCINATE--COA-LIGASE-GDP-FORMING-RXN|URKI-RXN|GUANYLCYC-RXN}}
+

Latest revision as of 21:19, 21 March 2018

Reaction RXN-10609

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • exostosin_family_protein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 UDP-α-D-glucuronate[c] + 1 3,5,3'-triiodo-L-thyronine[c] => 1 UDP[c] + 1 H+[c] + 1 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6261, thyroid hormone metabolism II (via conjugation and/or degradation): PWY-6261
    • 11 reactions found over 15 reactions in the full pathway

Reconstruction information

External links