Difference between revisions of "RXN-1381"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G3P G3P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(=O)[O-] * inchi key: ** InChIKey=OSJPPGNTCRNQ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1381 RXN-1381] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1381 RXN-1381] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.15 EC-2.3.1.15] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | + | * With identifiers: | |
| − | * [[ | + | ** 1 [[GLYCEROL-3P]][c] '''+''' 1 [[Long-Chain-Acyl-CoAs]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[ACYL-SN-GLYCEROL-3P]][c] |
| − | + | * With common name(s): | |
| − | + | ** 1 sn-glycerol 3-phosphate[c] '''+''' 1 a long-chain acyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 a 1-acyl-sn-glycerol 3-phosphate[c] | |
| − | + | ||
| − | * [ | + | == Genes associated with this reaction == |
| − | * [[ | + | == Pathways == |
| − | * [[ | + | * [[PWY-5667]], CDP-diacylglycerol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5667 PWY-5667] |
| − | * [[ | + | ** '''4''' reactions found over '''4''' reactions in the full pathway |
| − | * [[ | + | * [[TRIGLSYN-PWY]], diacylglycerol and triacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY] |
| − | * [[ | + | ** '''7''' reactions found over '''7''' reactions in the full pathway |
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15325 15325] | |
| − | + | * LIGAND-RXN: | |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00851 R00851] |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | * LIGAND- | + | {{#set: ec number=EC-2.3.1.15}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-5667|TRIGLSYN-PWY}} |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 20:19, 21 March 2018
Contents
Reaction RXN-1381
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 GLYCEROL-3P[c] + 1 Long-Chain-Acyl-CoAs[c] => 1 CO-A[c] + 1 ACYL-SN-GLYCEROL-3P[c]
- With common name(s):
- 1 sn-glycerol 3-phosphate[c] + 1 a long-chain acyl-CoA[c] => 1 coenzyme A[c] + 1 a 1-acyl-sn-glycerol 3-phosphate[c]
Genes associated with this reaction
Pathways
- PWY-5667, CDP-diacylglycerol biosynthesis I: PWY-5667
- 4 reactions found over 4 reactions in the full pathway
- TRIGLSYN-PWY, diacylglycerol and triacylglycerol biosynthesis: TRIGLSYN-PWY
- 7 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
