Difference between revisions of "CPD-7424"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14812 RXN-14812] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7424 CPD-7424] == * smiles: ** CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14812 RXN-14812] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7424 CPD-7424] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)
 +
* common name:
 +
** 9'-cis-neoxanthin
 +
* inchi key:
 +
** InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N
 +
* molecular weight:
 +
** 600.88   
 
* Synonym(s):
 
* Synonym(s):
 +
** 9cNeox
 +
** 9c-neoxanthin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-698]]
−
** 1 [[CPD-15709]][c] '''<=>''' 1 [[FRUCTOSE-6P]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 D-fructose 6-phosphate[c] '''<=>''' 1 &beta;-D-fructofuranose 6-phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282217 5282217]
−
{{#set: reconstruction category=annotation}}
+
* CHEMSPIDER:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.chemspider.com/Chemical-Structure.10392237.html 10392237]
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35306 35306]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C13431 C13431]
 +
{{#set: smiles=CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)}}
 +
{{#set: common name=9'-cis-neoxanthin}}
 +
{{#set: inchi key=InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N}}
 +
{{#set: molecular weight=600.88    }}
 +
{{#set: common name=9cNeox|9c-neoxanthin}}
 +
{{#set: consumed by=RXN-698}}

Latest revision as of 20:19, 21 March 2018

Metabolite CPD-7424

  • smiles:
    • CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)
  • common name:
    • 9'-cis-neoxanthin
  • inchi key:
    • InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N
  • molecular weight:
    • 600.88
  • Synonym(s):
    • 9cNeox
    • 9c-neoxanthin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-7424&oldid=47746"