Difference between revisions of "Enoylpimeloyl-ACP-methyl-esters"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYADENOSINE DEOXYADENOSINE] == * smiles: ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(N)N=CN=C23))) * com...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Enoylpimeloyl-ACP-methyl-esters Enoylpimeloyl-ACP-methyl-esters] == * common name: ** an enoylp...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYADENOSINE DEOXYADENOSINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Enoylpimeloyl-ACP-methyl-esters Enoylpimeloyl-ACP-methyl-esters] ==
* smiles:
+
** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(N)N=CN=C23)))
+
 
* common name:
 
* common name:
** 2'-deoxyadenosine
+
** an enoylpimeloyl-[acp] methyl ester
* inchi key:
+
** InChIKey=OLXZPDWKRNYJJZ-RRKCRQDMSA-N
+
* molecular weight:
+
** 251.244   
+
 
* Synonym(s):
 
* Synonym(s):
** deoxyadenosine
+
** an enoylpimelyl-[acyl-carrier protein] methyl ester
** 2-deoxy-adenosine
+
** an enoylpimelyl-[acp] methyl ester
 +
** an enoylpimeloyl-[acyl-carrier protein] methyl ester
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DAD2PT]]
+
* [[RXN-11482]]
* [[ADDALT-RXN]]
+
* [[EPMEACPR]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11481]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[DAMPH]]
 
 
== External links  ==
 
== External links  ==
* CAS : 958-09-8
+
{{#set: common name=an enoylpimeloyl-[acp] methyl ester}}
* BIGG : dad_2
+
{{#set: common name=an enoylpimelyl-[acyl-carrier protein] methyl ester|an enoylpimelyl-[acp] methyl ester|an enoylpimeloyl-[acyl-carrier protein] methyl ester}}
* PUBCHEM:
+
{{#set: consumed by=RXN-11482|EPMEACPR}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13730 13730]
+
{{#set: produced by=RXN-11481}}
* HMDB : HMDB00101
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00559 C00559]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.13135.html 13135]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17256 17256]
+
* METABOLIGHTS : MTBLC17256
+
{{#set: smiles=C(O)C1(OC(CC(O)1)N3(C=NC2(=C(N)N=CN=C23)))}}
+
{{#set: common name=2'-deoxyadenosine}}
+
{{#set: inchi key=InChIKey=OLXZPDWKRNYJJZ-RRKCRQDMSA-N}}
+
{{#set: molecular weight=251.244    }}
+
{{#set: common name=deoxyadenosine|2-deoxy-adenosine}}
+
{{#set: consumed by=DAD2PT|ADDALT-RXN}}
+
{{#set: reversible reaction associated=DAMPH}}
+

Latest revision as of 21:19, 21 March 2018

Metabolite Enoylpimeloyl-ACP-methyl-esters

  • common name:
    • an enoylpimeloyl-[acp] methyl ester
  • Synonym(s):
    • an enoylpimelyl-[acyl-carrier protein] methyl ester
    • an enoylpimelyl-[acp] methyl ester
    • an enoylpimeloyl-[acyl-carrier protein] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an enoylpimeloyl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "an enoylpimelyl-[acyl-carrier protein] methyl ester" cannot be used as a page name in this wiki.
  • "an enoylpimelyl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "an enoylpimeloyl-[acyl-carrier protein] methyl ester" cannot be used as a page name in this wiki.