Difference between revisions of "Tiso gene 4321"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Gene == Gene Tiso_gene_4321 == * Synonym(s): == Reactions associated == * Reaction: 2.4.1.223-RXN ** Source: orthology-esiliculosus == Pathways associate...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] ==
+
== Gene Tiso_gene_4321 ==
* smiles:
+
** CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
* inchi key:
+
** InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J
+
* common name:
+
** OPC8-3-ketoacyl-CoA
+
* molecular weight:
+
** 1053.904   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-10699]]
+
* Reaction: [[2.4.1.223-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
* [[RXN-10698]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
* [[PWY-6558]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=2.4.1.223-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237200 44237200]
+
{{#set: pathway associated=PWY-6558}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: inchi key=InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J}}
+
{{#set: common name=OPC8-3-ketoacyl-CoA}}
+
{{#set: molecular weight=1053.904    }}
+
{{#set: consumed by=RXN-10699}}
+
{{#set: produced by=RXN-10698}}
+

Latest revision as of 20:19, 21 March 2018

Gene Tiso_gene_4321

  • Synonym(s):

Reactions associated

Pathways associated

External links