Difference between revisions of "RXN-9635"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROPTERIN-CH2OH-PP DIHYDROPTERIN-CH2OH-PP] == * smiles: ** C2(C(COP(=O)([O-])OP(=O)([O-])[O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9635 RXN-9635] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-octadec-2-enoyl-[acyl-c...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROPTERIN-CH2OH-PP DIHYDROPTERIN-CH2OH-PP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9635 RXN-9635] ==
−
* smiles:
+
* direction:
−
** C2(C(COP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FCQGJGLSOWZZON-UHFFFAOYSA-K
+
 
* common name:
 
* common name:
−
** (7,8-dihydropterin-6-yl)methyl diphosphate
+
** trans-octadec-2-enoyl-[acyl-carrier-protein] reductase
−
* molecular weight:
+
* ec number:
−
** 352.116   
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** 6-hydroxymethyl-dihydropterin pyrophosphate
 
−
** 6-hydroxymethyl-dihydropterin diphosphate
 
−
** 6-hydroxymethyl-7,8-dihydropterin diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[H2PTEROATESYNTH-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Octadec-2-enoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[Stearoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
−
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a trans-octadec-2-enoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 a stearoyl-[acp][c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5989]], stearate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989]
 +
** '''5''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244074 25244074]
+
{{#set: common name=trans-octadec-2-enoyl-[acyl-carrier-protein] reductase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.3.1.9}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73083 73083]
+
{{#set: gene associated=Tiso_gene_10778}}
−
* BIGG : 6hmhptpp
+
{{#set: in pathway=PWY-5989}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology|manual}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04807 C04807]
+
{{#set: reconstruction source=orthology-athaliana|manual-primary_network|orthology-esiliculosus}}
−
{{#set: smiles=C2(C(COP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=FCQGJGLSOWZZON-UHFFFAOYSA-K}}
+
−
{{#set: common name=(7,8-dihydropterin-6-yl)methyl diphosphate}}
+
−
{{#set: molecular weight=352.116    }}
+
−
{{#set: common name=6-hydroxymethyl-dihydropterin pyrophosphate|6-hydroxymethyl-dihydropterin diphosphate|6-hydroxymethyl-7,8-dihydropterin diphosphate}}
+
−
{{#set: consumed by=H2PTEROATESYNTH-RXN}}
+
−
{{#set: produced by=H2PTERIDINEPYROPHOSPHOKIN-RXN}}
+

Latest revision as of 20:19, 21 March 2018

Reaction RXN-9635

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-octadec-2-enoyl-[acyl-carrier-protein] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5989, stearate biosynthesis II (bacteria and plants): PWY-5989
    • 5 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

"trans-octadec-2-enoyl-[acyl-carrier-protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9635&oldid=47798"