Difference between revisions of "AGK"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7424 CPD-7424] == * smiles: ** CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AGK AGK] == * direction: ** LEFT-TO-RIGHT * common name: ** acetylglutamate kinase * Synonym(s): =...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7424 CPD-7424] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AGK AGK] ==
−
* smiles:
+
* direction:
−
** CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 9'-cis-neoxanthin
+
** acetylglutamate kinase
−
* inchi key:
+
−
** InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N
+
−
* molecular weight:
+
−
** 600.88   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 9cNeox
 
−
** 9c-neoxanthin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-698]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ATP]][c] '''+''' 1.0 [[ACETYL-GLU]][c] '''=>''' 1.0 [[N-ACETYL-GLUTAMYL-P]][c] '''+''' 1.0 [[ADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 ATP[c] '''+''' 1.0 N-acetyl-L-glutamate[c] '''=>''' 1.0 N-acetylglutamyl-phosphate[c] '''+''' 1.0 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13144]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_12021]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282217 5282217]
+
{{#set: common name=acetylglutamate kinase}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_13144|Tiso_gene_12021}}
−
** [http://www.chemspider.com/Chemical-Structure.10392237.html 10392237]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35306 35306]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C13431 C13431]
+
−
{{#set: smiles=CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)}}
+
−
{{#set: common name=9'-cis-neoxanthin}}
+
−
{{#set: inchi key=InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N}}
+
−
{{#set: molecular weight=600.88    }}
+
−
{{#set: common name=9cNeox|9c-neoxanthin}}
+
−
{{#set: consumed by=RXN-698}}
+

Latest revision as of 21:19, 21 March 2018

Reaction AGK

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acetylglutamate kinase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] + 1.0 N-acetyl-L-glutamate[c] => 1.0 N-acetylglutamyl-phosphate[c] + 1.0 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=AGK&oldid=47832"