Difference between revisions of "CPD-466"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15582 == * Synonym(s): == Reactions associated == * DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN ** pantograph-esiliculosus * H2NEOPTE...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-466 CPD-466] == * smiles: ** CC(C[N+])C([O-])=O * common name: ** (S)-3-amino-2-methylpropa...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-466 CPD-466] == |
| + | * smiles: | ||
| + | ** CC(C[N+])C([O-])=O | ||
| + | * common name: | ||
| + | ** (S)-3-amino-2-methylpropanoate | ||
| + | * inchi key: | ||
| + | ** InChIKey=QCHPKSFMDHPSNR-VKHMYHEASA-N | ||
| + | * molecular weight: | ||
| + | ** 103.121 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** L-3-amino-isobutanoate | ||
| + | ** (S)-3-amino-isobutyric acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[2.6.1.22-RXN]] | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03284 C03284] |
| + | * HMDB : HMDB02166 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58655 58655] | ||
| + | * METABOLIGHTS : MTBLC58655 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971062 6971062] | ||
| + | {{#set: smiles=CC(C[N+])C([O-])=O}} | ||
| + | {{#set: common name=(S)-3-amino-2-methylpropanoate}} | ||
| + | {{#set: inchi key=InChIKey=QCHPKSFMDHPSNR-VKHMYHEASA-N}} | ||
| + | {{#set: molecular weight=103.121 }} | ||
| + | {{#set: common name=L-3-amino-isobutanoate|(S)-3-amino-isobutyric acid}} | ||
| + | {{#set: reversible reaction associated=2.6.1.22-RXN}} | ||
Latest revision as of 20:19, 21 March 2018
Contents
Metabolite CPD-466
- smiles:
- CC(C[N+])C([O-])=O
- common name:
- (S)-3-amino-2-methylpropanoate
- inchi key:
- InChIKey=QCHPKSFMDHPSNR-VKHMYHEASA-N
- molecular weight:
- 103.121
- Synonym(s):
- L-3-amino-isobutanoate
- (S)-3-amino-isobutyric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C[N+])C([O-])=O" cannot be used as a page name in this wiki.
