Difference between revisions of "CPD-12481"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14481 RXN-14481] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * common name: ** 7-methyl...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14481 RXN-14481] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
 +
* common name:
 +
** 7-methylurate
 +
* inchi key:
 +
** InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 182.138   
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-methyluric acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[CPD-15360]][c] '''=>''' 1 [[CPD-11592]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c]
+
* [[RXN-11521]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 S-adenosyl-L-methionine[c] '''+''' 1 2-thio-N6-dimethylallyladenosine37 in tRNA[c] '''=>''' 1 2-methylthio-N6-dimethylallyladenosine37 in tRNA[c] '''+''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_12431]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_12431}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69160 69160]
−
{{#set: in pathway=}}
+
* CHEMSPIDER:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.chemspider.com/Chemical-Structure.62375.html 62375]
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
* HMDB : HMDB11107
−
{{#set: reconstruction tool=pantograph}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80470 80470]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16355 C16355]
 +
{{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))}}
 +
{{#set: common name=7-methylurate}}
 +
{{#set: inchi key=InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=182.138    }}
 +
{{#set: common name=7-methyluric acid}}
 +
{{#set: produced by=RXN-11521}}

Latest revision as of 20:19, 21 March 2018

Metabolite CPD-12481

  • smiles:
    • CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
  • common name:
    • 7-methylurate
  • inchi key:
    • InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
  • molecular weight:
    • 182.138
  • Synonym(s):
    • 7-methyluric acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12481&oldid=47842"