Difference between revisions of "RXN-10695"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * i...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10695 RXN-10695] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10695 RXN-10695] ==
−
* smiles:
+
* direction:
−
** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N
+
** [http://enzyme.expasy.org/EC/6.2.1 EC-6.2.1]
−
* common name:
+
−
** 3-O-methylkaempferol
+
−
* molecular weight:
+
−
** 300.267   
+
 
* Synonym(s):
 
* Synonym(s):
−
** kaempferol 3-methyl ether
 
−
** 3-Methoxyapigenin
 
−
** isokaempferide
 
−
** 3-methylkaempferol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-13935]]
+
** 1 [[CO-A]][c] '''+''' 1 [[CPD-730]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[CPD-11517]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 coenzyme A[c] '''+''' 1 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate[c] '''+''' 1 ATP[c] '''=>''' 1 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA[c] '''+''' 1 AMP[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14183]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_12275]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735]
 +
** '''15''' reactions found over '''19''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280862 5280862]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07887 R07887]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1579 1579]
+
{{#set: ec number=EC-6.2.1}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_14183|Tiso_gene_12275}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05902 C05902]
+
{{#set: in pathway=PWY-735}}
−
{{#set: smiles=COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N}}
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: common name=3-O-methylkaempferol}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=300.267    }}
+
−
{{#set: common name=kaempferol 3-methyl ether|3-Methoxyapigenin|isokaempferide|3-methylkaempferol}}
+
−
{{#set: produced by=RXN-13935}}
+

Latest revision as of 21:19, 21 March 2018

Reaction RXN-10695

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 coenzyme A[c] + 1 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate[c] + 1 ATP[c] => 1 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA[c] + 1 AMP[c] + 1 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-735, jasmonic acid biosynthesis: PWY-735
    • 15 reactions found over 19 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-10695&oldid=47847"