Difference between revisions of "RXN66-162"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == * smiles: ** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-162 RXN66-162] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-162 RXN66-162] ==
* smiles:
+
* direction:
** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N
+
 
* common name:
 
* common name:
** XLLG xyloglucan oligosaccharide
+
** exostosin_family_protein
* molecular weight:
+
* ec number:
** 1387.215   
+
** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-12400]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[UDP-GLUCURONATE]][c] '''+''' 1 [[CPD-2750]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c] '''+''' 1 [[CPD-2752]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 UDP-α-D-glucuronate[c] '''+''' 1 trans-3'-hydroxycotinine[c] '''=>''' 1 H+[c] '''+''' 1 UDP[c] '''+''' 1 trans-3-hydroxycotinine-glucuronide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14140]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14141]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-221]], nicotine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-221 PWY66-221]
 +
** '''5''' reactions found over '''18''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940189 52940189]
+
{{#set: common name=exostosin_family_protein}}
{{#set: smiles=C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)}}
+
{{#set: ec number=EC-2.4.1.17}}
{{#set: inchi key=InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N}}
+
{{#set: gene associated=Tiso_gene_14140|Tiso_gene_14141}}
{{#set: common name=XLLG xyloglucan oligosaccharide}}
+
{{#set: in pathway=PWY66-221}}
{{#set: molecular weight=1387.215    }}
+
{{#set: reconstruction category=annotation}}
{{#set: consumed by=RXN-12400}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 21:19, 21 March 2018

Reaction RXN66-162

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • exostosin_family_protein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 UDP-α-D-glucuronate[c] + 1 trans-3'-hydroxycotinine[c] => 1 H+[c] + 1 UDP[c] + 1 trans-3-hydroxycotinine-glucuronide[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-221, nicotine degradation V: PWY66-221
    • 5 reactions found over 18 reactions in the full pathway

Reconstruction information

External links