Difference between revisions of "Tiso gene 20347"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19171 CPD-19171] == * smiles: ** CCCCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
(Created page with "Category:Gene == Gene Tiso_gene_20347 == * Synonym(s): == Reactions associated == * Reaction: PROTEIN-KINASE-RXN ** Source: orthology-esiliculosus == Pathways ass...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19171 CPD-19171] ==
+
== Gene Tiso_gene_20347 ==
* smiles:
+
** CCCCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=LHAYYTCFPMUQNR-DFXYPYGHSA-J
+
* common name:
+
** (S)-3-hydroxy-(9Z)-octadecenoyl-CoA
+
* molecular weight:
+
** 1043.952   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-18:1-Δ9-CoA
 
** (S)-3-hydroxy-9-cis-octadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17777]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
{{#set: inchi key=InChIKey=LHAYYTCFPMUQNR-DFXYPYGHSA-J}}
+
{{#set: common name=(S)-3-hydroxy-(9Z)-octadecenoyl-CoA}}
+
{{#set: molecular weight=1043.952    }}
+
{{#set: common name=(S)-3-hydroxy-18:1-Δ9-CoA|(S)-3-hydroxy-9-cis-octadecenoyl-CoA}}
+
{{#set: consumed by=RXN-17777}}
+

Latest revision as of 20:20, 21 March 2018

Gene Tiso_gene_20347

  • Synonym(s):

Reactions associated

Pathways associated

External links