Difference between revisions of "RXN-7580"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTO-14-FURANOSE UDP-D-GALACTO-14-FURANOSE] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7580 RXN-7580] == * direction: ** LEFT-TO-RIGHT * common name: ** ent-kaurenal 19-hydroxylase *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTO-14-FURANOSE UDP-D-GALACTO-14-FURANOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7580 RXN-7580] ==
* smiles:
+
* direction:
** C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L
+
 
* common name:
 
* common name:
** UDP-α-D-galactofuranose
+
** ent-kaurenal 19-hydroxylase
* molecular weight:
+
** 564.289   
+
 
* Synonym(s):
 
* Synonym(s):
** UDP-Galf
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[ENT-KAUR-16-EN-19-AL]][c] '''=>''' 1 [[CPD1F-132]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NADP]][c]
* [[GALPMUT-RXN]]
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 oxygen[c] '''+''' 1 ent-kaurenal[c] '''=>''' 1 ent-kaur-16-en-19-oate[c] '''+''' 1 H2O[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_1547]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_8263]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways  ==
 +
* [[PWY-5047]], gibberellin biosynthesis IV (Gibberella fujikuroi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047]
 +
** '''6''' reactions found over '''15''' reactions in the full pathway
 +
* [[PWY-5034]], GA12 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244316 25244316]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10931 10931]
* CHEBI:
+
* LIGAND-RXN:
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66915 66915]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06293 R06293]
* BIGG : udpgalfur
+
{{#set: direction=LEFT-TO-RIGHT}}
* LIGAND-CPD:
+
{{#set: common name=ent-kaurenal 19-hydroxylase}}
** [http://www.genome.jp/dbget-bin/www_bget?C03733 C03733]
+
{{#set: gene associated=Tiso_gene_1547|Tiso_gene_8263}}
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))}}
+
{{#set: in pathway=PWY-5047|PWY-5034}}
{{#set: inchi key=InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L}}
+
{{#set: reconstruction category=orthology}}
{{#set: common name=UDP-α-D-galactofuranose}}
+
{{#set: reconstruction source=orthology-athaliana}}
{{#set: molecular weight=564.289    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=UDP-Galf}}
+
{{#set: consumed or produced by=GALPMUT-RXN}}
+

Latest revision as of 21:20, 21 March 2018

Reaction RXN-7580

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ent-kaurenal 19-hydroxylase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5047, gibberellin biosynthesis IV (Gibberella fujikuroi): PWY-5047
    • 6 reactions found over 15 reactions in the full pathway
  • PWY-5034, GA12 biosynthesis: PWY-5034
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links