Difference between revisions of "Tiso gene 15094"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_15094 == * right end position: ** 3947 * transcription direction: ** NEGATIVE * left end position: ** 3241 * centisome position: ** 61.8747...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15094 == |
− | * | + | * right end position: |
− | ** | + | ** 3947 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 3241 |
− | * | + | * centisome position: |
− | ** | + | ** 61.87476 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[6.3.2.25-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3947}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=3241}} | |
− | + | {{#set: centisome position=61.87476 }} | |
− | + | {{#set: reaction associated=6.3.2.25-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 21:20, 21 March 2018
Gene Tiso_gene_15094
- right end position:
- 3947
- transcription direction:
- NEGATIVE
- left end position:
- 3241
- centisome position:
- 61.87476
- Synonym(s):
Reactions associated
- Reaction: 6.3.2.25-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation