Difference between revisions of "Tiso gene 15094"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * i...")
(Created page with "Category:Gene == Gene Tiso_gene_15094 == * right end position: ** 3947 * transcription direction: ** NEGATIVE * left end position: ** 3241 * centisome position: ** 61.8747...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] ==
+
== Gene Tiso_gene_15094 ==
−
* smiles:
+
* right end position:
−
** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))
+
** 3947
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 3-O-methylkaempferol
+
** 3241
−
* molecular weight:
+
* centisome position:
−
** 300.267    
+
** 61.87476    
 
* Synonym(s):
 
* Synonym(s):
−
** kaempferol 3-methyl ether
 
−
** 3-Methoxyapigenin
 
−
** isokaempferide
 
−
** 3-methylkaempferol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[6.3.2.25-RXN]]
−
* [[RXN-13935]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3947}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280862 5280862]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=3241}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1579 1579]
+
{{#set: centisome position=61.87476   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=6.3.2.25-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05902 C05902]
+
−
{{#set: smiles=COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))}}
+
−
{{#set: inchi key=InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N}}
+
−
{{#set: common name=3-O-methylkaempferol}}
+
−
{{#set: molecular weight=300.267   }}
+
−
{{#set: common name=kaempferol 3-methyl ether|3-Methoxyapigenin|isokaempferide|3-methylkaempferol}}
+
−
{{#set: produced by=RXN-13935}}
+

Latest revision as of 20:20, 21 March 2018

Gene Tiso_gene_15094

  • right end position:
    • 3947
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3241
  • centisome position:
    • 61.87476
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15094&oldid=47901"