Difference between revisions of "Tiso gene 15884"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] == * smiles: ** C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)(...")
(Created page with "Category:Gene == Gene Tiso_gene_15884 == * right end position: ** 1678 * transcription direction: ** NEGATIVE * left end position: ** 251 * centisome position: ** 5.30319...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] ==
+
== Gene Tiso_gene_15884 ==
* smiles:
+
* right end position:
** C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)([O-])OP(=O)([O-])OC3(OC(C([O-])=O)C(O)C(O)C(O)3)
+
** 1678
* inchi key:
+
* transcription direction:
** InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K
+
** NEGATIVE
* common name:
+
* left end position:
** UDP-α-D-glucuronate
+
** 251
* molecular weight:
+
* centisome position:
** 577.265    
+
** 5.30319    
 
* Synonym(s):
 
* Synonym(s):
** (UDP-GlcA)1
 
** UDP-D-glucuronic acid
 
** UDP-glucuronic acid
 
** udp-glcua
 
** UDP-glucuronate
 
** uridine diphosphate glucuronate
 
** uridine diphosphate glucuronic acid
 
** UDP-D-glucuronate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14361]]
+
* Reaction: [[RXN-15556]]
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-9000]]
+
*** Assignment: automated-name-match
* [[RXN-10618]]
+
== Pathways associated ==
* [[RXN-10619]]
+
* [[PWY-7511]]
* [[RXN-10616]]
+
* [[RXN-10617]]
+
* [[RXN-11060]]
+
* [[RXN66-83]]
+
* [[UGDC]]
+
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
+
* [[RXN-13608]]
+
* [[RXN-10609]]
+
* [[RXN-10608]]
+
* [[RXN-10607]]
+
* [[RXN-10606]]
+
* [[RXN-13607]]
+
* [[2.4.1.135-RXN]]
+
* [[RXN66-168]]
+
* [[RXN-10784]]
+
* [[2.4.1.225-RXN]]
+
* [[RXN66-162]]
+
== Reaction(s) known to produce the compound ==
+
* [[GLCUR1PUT]]
+
== Reaction(s) of unknown directionality ==
+
* [[2.7.7.44-RXN]]
+
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
+
 
== External links  ==
 
== External links  ==
* CAS : 2616-64-0
+
{{#set: right end position=1678}}
* METABOLIGHTS : MTBLC58052
+
{{#set: transcription direction=NEGATIVE}}
* PUBCHEM:
+
{{#set: left end position=251}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202620 25202620]
+
{{#set: centisome position=5.30319   }}
* HMDB : HMDB00935
+
{{#set: reaction associated=RXN-15556}}
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7511}}
** [http://www.genome.jp/dbget-bin/www_bget?C00167 C00167]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58052 58052]
+
* BIGG : udpglcur
+
{{#set: smiles=C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)([O-])OP(=O)([O-])OC3(OC(C([O-])=O)C(O)C(O)C(O)3)}}
+
{{#set: inchi key=InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K}}
+
{{#set: common name=UDP-α-D-glucuronate}}
+
{{#set: molecular weight=577.265   }}
+
{{#set: common name=(UDP-GlcA)1|UDP-D-glucuronic acid|UDP-glucuronic acid|udp-glcua|UDP-glucuronate|uridine diphosphate glucuronate|uridine diphosphate glucuronic acid|UDP-D-glucuronate}}
+
{{#set: consumed by=RXN-14361|UDP-GLUCURONATE-DECARBOXYLASE-RXN|RXN-9000|RXN-10618|RXN-10619|RXN-10616|RXN-10617|RXN-11060|RXN66-83|UGDC|UDP-GLUCURONOSYLTRANSFERASE-RXN|RXN-13608|RXN-10609|RXN-10608|RXN-10607|RXN-10606|RXN-13607|2.4.1.135-RXN|RXN66-168|RXN-10784|2.4.1.225-RXN|RXN66-162}}
+
{{#set: produced by=GLCUR1PUT}}
+
{{#set: consumed or produced by=2.7.7.44-RXN|UDP-GLUCURONATE-4-EPIMERASE-RXN}}
+

Latest revision as of 20:20, 21 March 2018

Gene Tiso_gene_15884

  • right end position:
    • 1678
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 251
  • centisome position:
    • 5.30319
  • Synonym(s):

Reactions associated

Pathways associated

External links