Difference between revisions of "Tiso gene 5272"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] == * smiles: ** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_5272 == * right end position: ** 5636 * transcription direction: ** POSITIVE * left end position: ** 2490 * centisome position: ** 18.18314...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] ==
+
== Gene Tiso_gene_5272 ==
* smiles:
+
* right end position:
** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 5636
* inchi key:
+
* transcription direction:
** InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J
+
** POSITIVE
* common name:
+
* left end position:
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA
+
** 2490
* molecular weight:
+
* centisome position:
** 967.814    
+
** 18.183146    
 
* Synonym(s):
 
* Synonym(s):
** 2E, 5Z, 7E-tetradecatrienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-11109]]
* [[RXN-14796]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=5636}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657959 90657959]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=2490}}
{{#set: inchi key=InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J}}
+
{{#set: centisome position=18.183146   }}
{{#set: common name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA}}
+
{{#set: reaction associated=RXN-11109}}
{{#set: molecular weight=967.814   }}
+
{{#set: common name=2E, 5Z, 7E-tetradecatrienoyl-CoA}}
+
{{#set: produced by=RXN-14796}}
+

Latest revision as of 21:20, 21 March 2018

Gene Tiso_gene_5272

  • right end position:
    • 5636
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2490
  • centisome position:
    • 18.183146
  • Synonym(s):

Reactions associated

Pathways associated

External links