Difference between revisions of "TusE-S-sulfanylcysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-4-PHOSPHATE D-MYO-INOSITOL-4-PHOSPHATE] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TusE-S-sulfanylcysteine TusE-S-sulfanylcysteine] == * common name: ** a [TusE sulfur carrier pr...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-4-PHOSPHATE D-MYO-INOSITOL-4-PHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TusE-S-sulfanylcysteine TusE-S-sulfanylcysteine] ==
* smiles:
+
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
 
* common name:
 
* common name:
** 1D-myo-inositol 4-monophosphate
+
** a [TusE sulfur carrier protein]-S-sulfanylcysteine
* inchi key:
+
** InChIKey=INAPMGSXUVUWAF-CNWJWELYSA-L
+
* molecular weight:
+
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
** D-myo-inositol 4-phosphate
 
** D-myo-inositol 4-monophosphate
 
** inositol 4-phosphate
 
** Ins(4)P1
 
** Ins(4)P
 
** Ins4P
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10952]]
+
* [[RXN0-2023]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.3.57-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 46495-39-0
+
{{#set: common name=a [TusE sulfur carrier protein]-S-sulfanylcysteine}}
* PUBCHEM:
+
{{#set: consumed by=RXN0-2023}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200523 25200523]
+
* HMDB : HMDB01313
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03546 C03546]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58469 58469]
+
* METABOLIGHTS : MTBLC58469
+
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
{{#set: common name=1D-myo-inositol 4-monophosphate}}
+
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-CNWJWELYSA-L}}
+
{{#set: molecular weight=258.121    }}
+
{{#set: common name=D-myo-inositol 4-phosphate|D-myo-inositol 4-monophosphate|inositol 4-phosphate|Ins(4)P1|Ins(4)P|Ins4P}}
+
{{#set: consumed by=RXN-10952}}
+
{{#set: produced by=3.1.3.57-RXN}}
+

Latest revision as of 20:20, 21 March 2018

Metabolite TusE-S-sulfanylcysteine

  • common name:
    • a [TusE sulfur carrier protein]-S-sulfanylcysteine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [TusE sulfur carrier protein]-S-sulfanylcysteine" cannot be used as a page name in this wiki.