Difference between revisions of "CPD-19205"

Latest revision as of 20:20, 21 March 2018

"C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_12619 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19205 CPD-19205] ==
-* left end position:
+* smiles:
-** 1258
+** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-]
-* transcription direction:
+* common name:
-** POSITIVE
+** L-4-hydroxyphenylglycine-L-arginine
-* right end position:
+* inchi key:
-** 3045
+** InChIKey=YGJWDZHQJBXRDU-QWRGUYRKSA-O
-* centisome position:
+* molecular weight:
-** 18.429535
+** 324.359
 * Synonym(s):
+** L-pHPG-L-Arg
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[RXN-15556]]
+== Reaction(s) known to produce the compound ==
-** experimental_annotation
+* [[RXN-17832]]
-***automated-name-match
+== Reaction(s) of unknown directionality ==
-== Pathways associated ==
-* [[PWY-7511]]
 == External links  ==
-{{#set: left end position=1258}}
+{{#set: smiles=C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-]}}
-{{#set: transcription direction=POSITIVE}}
+{{#set: common name=L-4-hydroxyphenylglycine-L-arginine}}
-{{#set: right end position=3045}}
+{{#set: inchi key=InChIKey=YGJWDZHQJBXRDU-QWRGUYRKSA-O}}
-{{#set: centisome position=18.429535    }}
+{{#set: molecular weight=324.359    }}
-{{#set: reaction associated=RXN-15556}}
+{{#set: common name=L-pHPG-L-Arg}}
-{{#set: pathway associated=PWY-7511}}
+{{#set: produced by=RXN-17832}}