Difference between revisions of "Tiso gene 17"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-29 CPD66-29] == * smiles: ** CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_17 == * right end position: ** 18409 * transcription direction: ** POSITIVE * left end position: ** 16660 * centisome position: ** 33.61107...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17 == |
− | * | + | * right end position: |
− | ** | + | ** 18409 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 16660 |
− | * | + | * centisome position: |
− | ** | + | ** 33.611073 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN0-1321]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6700]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=18409}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=16660}} | |
− | + | {{#set: centisome position=33.611073 }} | |
− | + | {{#set: reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN|RXN0-1321}} | |
− | + | {{#set: pathway associated=PWY-6700}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:20, 21 March 2018
Gene Tiso_gene_17
- right end position:
- 18409
- transcription direction:
- POSITIVE
- left end position:
- 16660
- centisome position:
- 33.611073
- Synonym(s):
Reactions associated
- Reaction: QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN0-1321
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation