Difference between revisions of "RXN-15117"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * common name: ** 7-methyl...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15117 RXN-15117] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15117 RXN-15117] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.4.1.315 EC-2.4.1.315] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-12575]][c] '''+''' 1 [[D-Glucosyl-12-diacyl-glycerols]][c] '''=>''' 1 [[diacyl-3-O-glucl-1-6-gluc-sn-glycerol]][c] '''+''' 1 [[UDP]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
+ | ** 1 UDP-α-D-glucose[c] '''+''' 1 a 1,2-diacyl-3-O-(β-D-glucopyranosyl)-sn-glycerol[c] '''=>''' 1 a 1,2-diacyl-3-O-(β-D-glucopyranosyl-(1->6)-O-β-D-glucopyranosyl)-sn-glycerol[c] '''+''' 1 UDP[c] '''+''' 1 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_3385]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_412]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_15372]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_12341]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_19034]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_10734]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_7966]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_9428]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_15050]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_11792]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_17894]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_10863]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7817]], type I lipoteichoic acid biosynthesis (S. aureus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7817 PWY-7817] | ||
+ | ** '''7''' reactions found over '''16''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-2.4.1.315}} | |
− | + | {{#set: gene associated=Tiso_gene_3385|Tiso_gene_412|Tiso_gene_15372|Tiso_gene_12341|Tiso_gene_19034|Tiso_gene_10734|Tiso_gene_7966|Tiso_gene_9428|Tiso_gene_15050|Tiso_gene_11792|Tiso_gene_17894|Tiso_gene_10863}} | |
− | + | {{#set: in pathway=PWY-7817}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-athaliana}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:20, 21 March 2018
Contents
Reaction RXN-15117
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-12575[c] + 1 D-Glucosyl-12-diacyl-glycerols[c] => 1 diacyl-3-O-glucl-1-6-gluc-sn-glycerol[c] + 1 UDP[c] + 1 PROTON[c]
- With common name(s):
- 1 UDP-α-D-glucose[c] + 1 a 1,2-diacyl-3-O-(β-D-glucopyranosyl)-sn-glycerol[c] => 1 a 1,2-diacyl-3-O-(β-D-glucopyranosyl-(1->6)-O-β-D-glucopyranosyl)-sn-glycerol[c] + 1 UDP[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3385
- Source: orthology-athaliana
- Gene: Tiso_gene_412
- Source: orthology-athaliana
- Gene: Tiso_gene_15372
- Source: orthology-athaliana
- Gene: Tiso_gene_12341
- Source: orthology-athaliana
- Gene: Tiso_gene_19034
- Source: orthology-athaliana
- Gene: Tiso_gene_10734
- Source: orthology-athaliana
- Gene: Tiso_gene_7966
- Source: orthology-athaliana
- Gene: Tiso_gene_9428
- Source: orthology-athaliana
- Gene: Tiso_gene_15050
- Source: orthology-athaliana
- Gene: Tiso_gene_11792
- Source: orthology-athaliana
- Gene: Tiso_gene_17894
- Source: orthology-athaliana
- Gene: Tiso_gene_10863
- Source: orthology-athaliana
Pathways
- PWY-7817, type I lipoteichoic acid biosynthesis (S. aureus): PWY-7817
- 7 reactions found over 16 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-athaliana