Difference between revisions of "NN-DIMETHYLANILINE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19684 == * left end position: ** 230 * transcription direction: ** POSITIVE * right end position: ** 2065 * centisome position: ** 10.87984...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE NN-DIMETHYLANILINE] == * smiles: ** CN(C1(C=CC=CC=1))C * common name: ** N,N...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE NN-DIMETHYLANILINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CN(C1(C=CC=CC=1))C |
| − | * | + | * common name: |
| − | ** | + | ** N,N-dimethylaniline |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 121.182 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[1.14.13.8-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=949 949] |
| − | {{#set: | + | * NCI: |
| − | {{#set: | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=7195 7195] |
| − | {{#set: | + | * HMDB : HMDB01020 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02846 C02846] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.924.html 924] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16269 16269] | ||
| + | {{#set: smiles=CN(C1(C=CC=CC=1))C}} | ||
| + | {{#set: common name=N,N-dimethylaniline}} | ||
| + | {{#set: inchi key=InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=121.182 }} | ||
| + | {{#set: consumed by=1.14.13.8-RXN}} | ||
Latest revision as of 21:20, 21 March 2018
Contents
Metabolite NN-DIMETHYLANILINE
- smiles:
- CN(C1(C=CC=CC=1))C
- common name:
- N,N-dimethylaniline
- inchi key:
- InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N
- molecular weight:
- 121.182
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
