Difference between revisions of "CPD-676"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-474 RXN66-474] == * direction: ** LEFT-TO-RIGHT * common name: ** straight chain (R)-2-hydrox...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-676 CPD-676] == * smiles: ** C([O-])(=O)C=CC1(C=C(O)C(O)=CC=1) * common name: ** trans-caff...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-474 RXN66-474] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-676 CPD-676] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([O-])(=O)C=CC1(C=C(O)C(O)=CC=1)
 
* common name:
 
* common name:
−
** straight chain (R)-2-hydroxy fatty acyl-CoA ligase
+
** trans-caffeate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/6.2.1 EC-6.2.1]
+
** InChIKey=QAIPRVGONGVQAS-DUXPYHPUSA-M
 +
* molecular weight:
 +
** 179.152   
 
* Synonym(s):
 
* Synonym(s):
 +
** trans-caffeic acid
 +
** 3,4-dihydroxy-trans-cinnamate
 +
** (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-1126]]
−
** 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[R2OH-Straight-Chain-234-Sat-FA]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[R2-2OH-Straight-Chain-234-Sat-FA-CoA]][c]
+
* [[RXN-1104]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 ATP[c] '''+''' 1 coenzyme A[c] '''+''' 1 a (2R)-2-hydroxy even numbered straight chain 2,3,4-saturated fatty acid[c] '''=>''' 1 diphosphate[c] '''+''' 1 AMP[c] '''+''' 1 a (R)-2-hydroxy even numbered straight chain 2,3,4-saturated fatty acyl CoA[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY66-388]], fatty acid α-oxidation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-388 PWY66-388]
+
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=straight chain (R)-2-hydroxy fatty acyl-CoA ligase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54691412 54691412]
−
{{#set: ec number=EC-6.2.1}}
+
* HMDB : HMDB03501
−
{{#set: in pathway=PWY66-388}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01197 C01197]
−
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
* CHEMSPIDER:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.chemspider.com/Chemical-Structure.4450294.html 4450294]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57770 57770]
 +
* METABOLIGHTS : MTBLC57770
 +
{{#set: smiles=C([O-])(=O)C=CC1(C=C(O)C(O)=CC=1)}}
 +
{{#set: common name=trans-caffeate}}
 +
{{#set: inchi key=InChIKey=QAIPRVGONGVQAS-DUXPYHPUSA-M}}
 +
{{#set: molecular weight=179.152    }}
 +
{{#set: common name=trans-caffeic acid|3,4-dihydroxy-trans-cinnamate|(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid}}
 +
{{#set: consumed by=RXN-1126|RXN-1104}}

Latest revision as of 20:21, 21 March 2018

Metabolite CPD-676

  • smiles:
    • C([O-])(=O)C=CC1(C=C(O)C(O)=CC=1)
  • common name:
    • trans-caffeate
  • inchi key:
    • InChIKey=QAIPRVGONGVQAS-DUXPYHPUSA-M
  • molecular weight:
    • 179.152
  • Synonym(s):
    • trans-caffeic acid
    • 3,4-dihydroxy-trans-cinnamate
    • (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C=CC1(C=C(O)C(O)=CC=1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-676&oldid=47999"