Difference between revisions of "Tetradec-2-enoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tetradec-2-enoyl-ACPs Tetradec-2-enoyl-ACPs] == * common name: ** a trans tetradec-2-enoyl-[acp...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tetradec-2-enoyl-ACPs Tetradec-2-enoyl-ACPs] ==
* smiles:
+
** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C
+
* inchi key:
+
** InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N
+
 
* common name:
 
* common name:
** zeinoxanthin
+
** a trans tetradec-2-enoyl-[acp]
* molecular weight:
+
** 552.882   
+
 
* Synonym(s):
 
* Synonym(s):
** β,ε-carotene-3-ol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-5962]]
+
* [[RXN-9662]]
 +
* [[RXN-9538]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5961]]
+
* [[RXN-9537]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a trans tetradec-2-enoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10311902 10311902]
+
{{#set: consumed by=RXN-9662|RXN-9538}}
* CHEMSPIDER:
+
{{#set: produced by=RXN-9537}}
** [http://www.chemspider.com/Chemical-Structure.8487368.html 8487368]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65244 65244]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C08590 C08590]
+
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C}}
+
{{#set: inchi key=InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N}}
+
{{#set: common name=zeinoxanthin}}
+
{{#set: molecular weight=552.882    }}
+
{{#set: common name=β,ε-carotene-3-ol}}
+
{{#set: consumed by=RXN-5962}}
+
{{#set: produced by=RXN-5961}}
+

Latest revision as of 20:21, 21 March 2018

Metabolite Tetradec-2-enoyl-ACPs

  • common name:
    • a trans tetradec-2-enoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a trans tetradec-2-enoyl-[acp" cannot be used as a page name in this wiki.