Difference between revisions of "Tiso gene 18988"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-] * inchi key: ** InChIKey=HOB...") |
(Created page with "Category:Gene == Gene Tiso_gene_18988 == * Synonym(s): == Reactions associated == * Reaction: TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN ** Source: annotation-in-silico_anno...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_18988 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]] | |
| − | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
| − | == | + | *** Assignment: ec-number |
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 20:21, 21 March 2018
Gene Tiso_gene_18988
- Synonym(s):
Reactions associated
- Reaction: TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
