Difference between revisions of "CPD-12045"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13537 == * Synonym(s): == Reactions associated == * 1.4.3.19-RXN ** pantograph-synechocystis == Pathways associated == * PWY...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] == * smiles: ** C(O)C1(C(O)C(O)C(O)O1) * common name: ** α-L-arabino...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] == |
+ | * smiles: | ||
+ | ** C(O)C1(C(O)C(O)C(O)O1) | ||
+ | * common name: | ||
+ | ** α-L-arabinofuranose | ||
+ | * inchi key: | ||
+ | ** InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N | ||
+ | * molecular weight: | ||
+ | ** 150.131 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** α-L-arabinose | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[3.2.1.55-RXN]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * DRUGBANK : DB03142 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445935 445935] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.393416.html 393416] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28772 28772] | ||
+ | {{#set: smiles=C(O)C1(C(O)C(O)C(O)O1)}} | ||
+ | {{#set: common name=α-L-arabinofuranose}} | ||
+ | {{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N}} | ||
+ | {{#set: molecular weight=150.131 }} | ||
+ | {{#set: common name=α-L-arabinose}} | ||
+ | {{#set: produced by=3.2.1.55-RXN}} |
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CPD-12045
- smiles:
- C(O)C1(C(O)C(O)C(O)O1)
- common name:
- α-L-arabinofuranose
- inchi key:
- InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N
- molecular weight:
- 150.131
- Synonym(s):
- α-L-arabinose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links