Difference between revisions of "CPD-12045"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_17305 == * Synonym(s): == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-athaliana == Pathways associated == *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] == * smiles: ** C(O)C1(C(O)C(O)C(O)O1) * common name: ** α-L-arabino...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_17305 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] ==
 +
* smiles:
 +
** C(O)C1(C(O)C(O)C(O)O1)
 +
* common name:
 +
** α-L-arabinofuranose
 +
* inchi key:
 +
** InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N
 +
* molecular weight:
 +
** 150.131   
 
* Synonym(s):
 
* Synonym(s):
 +
** α-L-arabinose
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[RXN-8443]]
+
== Reaction(s) known to produce the compound ==
** Source: [[orthology-athaliana]]
+
* [[3.2.1.55-RXN]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-5381]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-8443}}
+
* DRUGBANK : DB03142
{{#set: pathway associated=PWY-5381}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445935 445935]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.393416.html 393416]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28772 28772]
 +
{{#set: smiles=C(O)C1(C(O)C(O)C(O)O1)}}
 +
{{#set: common name=α-L-arabinofuranose}}
 +
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N}}
 +
{{#set: molecular weight=150.131    }}
 +
{{#set: common name=α-L-arabinose}}
 +
{{#set: produced by=3.2.1.55-RXN}}

Latest revision as of 20:21, 21 March 2018

Metabolite CPD-12045

  • smiles:
    • C(O)C1(C(O)C(O)C(O)O1)
  • common name:
    • α-L-arabinofuranose
  • inchi key:
    • InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N
  • molecular weight:
    • 150.131
  • Synonym(s):
    • α-L-arabinose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links