|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATPSYN-RXN ATPSYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) |
| * common name: | | * common name: |
− | ** v-type_proton_atpase | + | ** chorismate |
− | ** ORF | + | * inchi key: |
− | ** vacuolar_h+-_sector_c | + | ** InChIKey=WTFXTQVDAKGDEY-HTQZYQBOSA-L |
− | ** v-type_proton_atpase_catalytic_subunit_a
| + | * molecular weight: |
− | ** vacuolar_h+-atpase_v0_subunits_a | + | ** 224.17 |
− | ** atp_synthase_gamma_chloroplastic
| + | |
− | ** atp_synthase_gamma_subunit
| + | |
− | ** atp_synthase_subunit_mitochondrial
| + | |
− | ** ycf35
| + | |
− | ** atp_synthase_delta_mitochondrial
| + | |
− | ** v-type_proton_atpase_subunit_h
| + | |
− | ** v-type_protonatpasesubunitd1
| + | |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/3.6.3.14 EC-3.6.3.14] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** chorismic acid |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[ADP]][c] '''+''' 4 [[PROTON]][e] '''+''' 1 [[Pi]][c] '''<=>''' 3 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[ATP]][c]
| + | * [[CHORISMATE-SYNTHASE-RXN]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 ADP[c] '''+''' 4 H+[e] '''+''' 1 phosphate[c] '''<=>''' 3 H+[c] '''+''' 1 H2O[c] '''+''' 1 ATP[c]
| + | * [[PABASYN-RXN]] |
− | | + | * [[CHORISMATEMUT-RXN]] |
− | == Genes associated with this reaction ==
| + | * [[ISOCHORSYN-RXN]] |
− | Genes have been associated with this reaction based on different elements listed below.
| + | * [[ANTHRANSYN-RXN]] |
− | * Gene: [[Tiso_gene_7213]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_2798]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_1366]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_10981]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_15850]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_7215]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_18105]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_6012]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_12618]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: AUTOMATED-NAME-MATCH
| + | |
− | * Gene: [[Tiso_gene_11754]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_9460]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_11192]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_11155]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_5307]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_6592]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_17383]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_1365]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_11753]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | == Pathways == | + | |
− | * [[PWY-7219]], adenosine ribonucleotides de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7219 PWY-7219] | + | |
− | ** '''4''' reactions found over '''4''' reactions in the full pathway | + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]] | + | |
− | * Category: [[manual]]
| + | |
− | ** Source: [[manual-primary_network]]
| + | |
− | * Category: [[annotation]] | + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 55508-12-8 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20852 20852] | + | * PUBCHEM: |
− | {{#set: direction=REVERSIBLE}}
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460312 5460312] |
− | {{#set: common name=v-type_proton_atpase}}
| + | * HMDB : HMDB12199 |
− | {{#set: common name=ORF}}
| + | * LIGAND-CPD: |
− | {{#set: common name=vacuolar_h+-_sector_c}}
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00251 C00251] |
− | {{#set: common name=v-type_proton_atpase_catalytic_subunit_a}}
| + | * CHEMSPIDER: |
− | {{#set: common name=vacuolar_h+-atpase_v0_subunits_a}}
| + | ** [http://www.chemspider.com/Chemical-Structure.4573889.html 4573889] |
− | {{#set: common name=atp_synthase_gamma_chloroplastic}}
| + | * CHEBI: |
− | {{#set: common name=atp_synthase_gamma_subunit}}
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29748 29748] |
− | {{#set: common name=atp_synthase_subunit_mitochondrial}}
| + | * BIGG : chor |
− | {{#set: common name=ycf35}} | + | {{#set: smiles=C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1)}} |
− | {{#set: common name=atp_synthase_delta_mitochondrial}}
| + | {{#set: common name=chorismate}} |
− | {{#set: common name=v-type_proton_atpase_subunit_h}} | + | {{#set: inchi key=InChIKey=WTFXTQVDAKGDEY-HTQZYQBOSA-L}} |
− | {{#set: common name=v-type_protonatpasesubunitd1}} | + | {{#set: molecular weight=224.17 }} |
− | {{#set: ec number=EC-3.6.3.14}} | + | {{#set: common name=chorismic acid}} |
− | {{#set: gene associated=Tiso_gene_7213|Tiso_gene_2798|Tiso_gene_1366|Tiso_gene_10981|Tiso_gene_15850|Tiso_gene_7215|Tiso_gene_18105|Tiso_gene_6012|Tiso_gene_12618|Tiso_gene_11754|Tiso_gene_9460|Tiso_gene_11192|Tiso_gene_11155|Tiso_gene_5307|Tiso_gene_6592|Tiso_gene_17383|Tiso_gene_1365|Tiso_gene_11753}} | + | {{#set: produced by=CHORISMATE-SYNTHASE-RXN}} |
− | {{#set: in pathway=PWY-7219}} | + | {{#set: reversible reaction associated=PABASYN-RXN|CHORISMATEMUT-RXN|ISOCHORSYN-RXN|ANTHRANSYN-RXN}} |
− | {{#set: reconstruction category=orthology|manual|annotation}} | + | |
− | {{#set: reconstruction source=annotation-in-silico_annotation|manual-primary_network|annotation-experimental_annotation|orthology-esiliculosus}}
| + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |