Difference between revisions of "CPD-8120"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Behenoyl-ACPs Behenoyl-ACPs] == * common name: ** a behenoyl-[acp] * Synonym(s): == Reaction(s...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-] * common name: ** di-homo-&g...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == |
| + | * smiles: | ||
| + | ** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-] | ||
* common name: | * common name: | ||
| − | ** | + | ** di-homo-γ-linolenate |
| + | * inchi key: | ||
| + | ** InChIKey=HOBAELRKJCKHQD-QNEBEIHSSA-M | ||
| + | * molecular weight: | ||
| + | ** 305.479 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (8Z,11Z,14Z)-eicosatrienoic acid | ||
| + | ** DGLA | ||
| + | ** (8Z,11Z,14Z)-eicosatri-8,11,14-enoate | ||
| + | ** (8Z,11Z,14Z)-icosatrienoate | ||
| + | ** di-homo-γ-linolenic acid | ||
| + | ** (Z,Z,Z)-8,11,14-eicosatrienoic acid | ||
| + | ** (Z,Z,Z)-8,11,14-eicosatrienoate | ||
| + | ** (8Z,11Z,14Z)-eicosatrienoate | ||
| + | ** (8Z,11Z,14Z)-icosatrienoic acid | ||
| + | ** (8Z,11Z,14Z)-icosa-8,11,14-trienoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13435]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * Wikipedia : Dihomo-gamma-linolenic_acid |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21158448 21158448] |
| + | * HMDB : HMDB02925 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03242 C03242] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.20117973.html 20117973] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71589 71589] | ||
| + | {{#set: smiles=CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-]}} | ||
| + | {{#set: common name=di-homo-γ-linolenate}} | ||
| + | {{#set: inchi key=InChIKey=HOBAELRKJCKHQD-QNEBEIHSSA-M}} | ||
| + | {{#set: molecular weight=305.479 }} | ||
| + | {{#set: common name=(8Z,11Z,14Z)-eicosatrienoic acid|DGLA|(8Z,11Z,14Z)-eicosatri-8,11,14-enoate|(8Z,11Z,14Z)-icosatrienoate|di-homo-γ-linolenic acid|(Z,Z,Z)-8,11,14-eicosatrienoic acid|(Z,Z,Z)-8,11,14-eicosatrienoate|(8Z,11Z,14Z)-eicosatrienoate|(8Z,11Z,14Z)-icosatrienoic acid|(8Z,11Z,14Z)-icosa-8,11,14-trienoate}} | ||
| + | {{#set: produced by=RXN-13435}} | ||
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CPD-8120
- smiles:
- CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-]
- common name:
- di-homo-γ-linolenate
- inchi key:
- InChIKey=HOBAELRKJCKHQD-QNEBEIHSSA-M
- molecular weight:
- 305.479
- Synonym(s):
- (8Z,11Z,14Z)-eicosatrienoic acid
- DGLA
- (8Z,11Z,14Z)-eicosatri-8,11,14-enoate
- (8Z,11Z,14Z)-icosatrienoate
- di-homo-γ-linolenic acid
- (Z,Z,Z)-8,11,14-eicosatrienoic acid
- (Z,Z,Z)-8,11,14-eicosatrienoate
- (8Z,11Z,14Z)-eicosatrienoate
- (8Z,11Z,14Z)-icosatrienoic acid
- (8Z,11Z,14Z)-icosa-8,11,14-trienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- Wikipedia : Dihomo-gamma-linolenic_acid
- PUBCHEM:
- HMDB : HMDB02925
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.
