Difference between revisions of "Behenoyl-ACPs"

Latest revision as of 21:21, 21 March 2018

"a behenoyl-[acp" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Behenoyl-ACPs Behenoyl-ACPs] ==
-* smiles:
-** CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
-* inchi key:
-** InChIKey=RCVJZGBRLGUTKT-CGGPSVLLSA-J
 * common name:
-** (5Z)-dodecenoyl-CoA
+** a behenoyl-[acp]
-* molecular weight:
-** 943.792
 * Synonym(s):
-** 12:1-&Delta;5-CoA
-** cis-5-tetradecenoyl-CoA
-** 12:1(n-7)-CoA
-** (5Z)-tetradec-5-enoyl-CoA
 == Reaction(s) known to consume the compound ==
-* [[RXN-17796]]
+* [[RXN1G-499]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17795]]
+* [[RXN1G-488]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: smiles=CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+{{#set: common name=a behenoyl-[acp]}}
-{{#set: inchi key=InChIKey=RCVJZGBRLGUTKT-CGGPSVLLSA-J}}
+{{#set: consumed by=RXN1G-499}}
-{{#set: common name=(5Z)-dodecenoyl-CoA}}
+{{#set: produced by=RXN1G-488}}
-{{#set: molecular weight=943.792    }}
-{{#set: common name=12:1-&Delta;5-CoA|cis-5-tetradecenoyl-CoA|12:1(n-7)-CoA|(5Z)-tetradec-5-enoyl-CoA}}
-{{#set: consumed by=RXN-17796}}
-{{#set: produced by=RXN-17795}}